Minecraft/cc-mek-scada
1
0
Fork 0
mirror of https://github.com/MikaylaFischler/cc-mek-scada.git synced 2024-08-30 18:22:34 +00:00
Code Issues Packages Projects Releases Wiki Activity

Merge pull request #316 from MikaylaFischler/232-waste-valve-and-flow-monitoring-display

Browse Source 
232 Waste Valve and Flow Monitoring Display
This commit is contained in:
Mikayla 2023-08-21 21:54:22 -04:00 committed by GitHub
commit 2acd166c3e
No known key found for this signature in database
GPG Key ID: 4AEE18F83AFDEB23
24 changed files with 1464 additions and 250 deletions
Show Stats Download Patch File Download Diff File Expand all files Collapse all files

3
coordinator/config.lua
View File

@ -26,6 +26,9 @@ config.SOUNDER_VOLUME = 1.0
-- true for 24 hour time on main view screen -- true for 24 hour time on main view screen
config.TIME_24_HOUR = true config.TIME_24_HOUR = true
-- disable flow view (for legacy layouts)
config.DISABLE_FLOW_VIEW = false
-- log path -- log path
config.LOG_PATH = "/log.txt" config.LOG_PATH = "/log.txt"
-- log mode -- log mode

57
coordinator/coordinator.lua
View File

@ -49,12 +49,15 @@ end
-- configure monitor layout -- configure monitor layout
---@param num_units integer number of units expected ---@param num_units integer number of units expected
---@param disable_flow_view boolean disable flow view (legacy)
---@return boolean success, monitors_struct? monitors ---@return boolean success, monitors_struct? monitors
function coordinator.configure_monitors(num_units) function coordinator.configure_monitors(num_units, disable_flow_view)
---@class monitors_struct ---@class monitors_struct
local monitors = { local monitors = {
primary = nil, primary = nil,
primary_name = "", primary_name = "",
flow = nil,
flow_name = "",
unit_displays = {}, unit_displays = {},
unit_name_map = {} unit_name_map = {}
} }
@ -69,8 +72,8 @@ function coordinator.configure_monitors(num_units)
table.insert(available, iface) table.insert(available, iface)
end end
-- we need a certain number of monitors (1 per unit + 1 primary display) -- we need a certain number of monitors (1 per unit + 1 primary display + 1 flow display)
local num_displays_needed = num_units + 1 local num_displays_needed = num_units + util.trinary(disable_flow_view, 1, 2)
if #names < num_displays_needed then if #names < num_displays_needed then
local message = "not enough monitors connected (need " .. num_displays_needed .. ")" local message = "not enough monitors connected (need " .. num_displays_needed .. ")"
println(message) println(message)
@ -83,10 +86,12 @@ function coordinator.configure_monitors(num_units)
log.warning("configure_monitors(): failed to load coordinator settings file (may not exist yet)") log.warning("configure_monitors(): failed to load coordinator settings file (may not exist yet)")
else else
local _primary = settings.get("PRIMARY_DISPLAY") local _primary = settings.get("PRIMARY_DISPLAY")
local _flow = settings.get("FLOW_DISPLAY")
local _unitd = settings.get("UNIT_DISPLAYS") local _unitd = settings.get("UNIT_DISPLAYS")
-- filter out already assigned monitors -- filter out already assigned monitors
util.filter_table(available, function (x) return x ~= _primary end) util.filter_table(available, function (x) return x ~= _primary end)
util.filter_table(available, function (x) return x ~= _flow end)
if type(_unitd) == "table" then if type(_unitd) == "table" then
util.filter_table(available, function (x) return not util.table_contains(_unitd, x) end) util.filter_table(available, function (x) return not util.table_contains(_unitd, x) end)
end end
@ -106,7 +111,6 @@ function coordinator.configure_monitors(num_units)
end end
while iface_primary_display == nil and #available > 0 do while iface_primary_display == nil and #available > 0 do
-- lets get a monitor
iface_primary_display = ask_monitor(available) iface_primary_display = ask_monitor(available)
end end
@ -118,6 +122,33 @@ function coordinator.configure_monitors(num_units)
monitors.primary = ppm.get_periph(iface_primary_display) monitors.primary = ppm.get_periph(iface_primary_display)
monitors.primary_name = iface_primary_display monitors.primary_name = iface_primary_display
--------------------------
-- FLOW MONITOR DISPLAY --
--------------------------
if not disable_flow_view then
local iface_flow_display = settings.get("FLOW_DISPLAY") ---@type boolean|string|nil
if not util.table_contains(names, iface_flow_display) then
println("flow monitor display is not connected")
local response = dialog.ask_y_n("would you like to change it", true)
if response == false then return false end
iface_flow_display = nil
end
while iface_flow_display == nil and #available > 0 do
iface_flow_display = ask_monitor(available)
end
if type(iface_flow_display) ~= "string" then return false end
settings.set("FLOW_DISPLAY", iface_flow_display)
util.filter_table(available, function (x) return x ~= iface_flow_display end)
monitors.flow = ppm.get_periph(iface_flow_display)
monitors.flow_name = iface_flow_display
end
------------------- -------------------
-- UNIT DISPLAYS -- -- UNIT DISPLAYS --
------------------- -------------------
@ -130,7 +161,6 @@ function coordinator.configure_monitors(num_units)
local display = nil local display = nil
while display == nil and #available > 0 do while display == nil and #available > 0 do
-- lets get a monitor
println("please select monitor for unit #" .. i) println("please select monitor for unit #" .. i)
display = ask_monitor(available) display = ask_monitor(available)
end end
@ -152,7 +182,6 @@ function coordinator.configure_monitors(num_units)
end end
while display == nil and #available > 0 do while display == nil and #available > 0 do
-- lets get a monitor
display = ask_monitor(available) display = ask_monitor(available)
end end
@ -217,12 +246,13 @@ end
---@nodiscard ---@nodiscard
---@param version string coordinator version ---@param version string coordinator version
---@param nic nic network interface device ---@param nic nic network interface device
---@param num_units integer number of configured units for number of monitors, checked against SV
---@param crd_channel integer port of configured supervisor ---@param crd_channel integer port of configured supervisor
---@param svr_channel integer listening port for supervisor replys ---@param svr_channel integer listening port for supervisor replys
---@param pkt_channel integer listening port for pocket API ---@param pkt_channel integer listening port for pocket API
---@param range integer trusted device connection range ---@param range integer trusted device connection range
---@param sv_watchdog watchdog ---@param sv_watchdog watchdog
function coordinator.comms(version, nic, crd_channel, svr_channel, pkt_channel, range, sv_watchdog) function coordinator.comms(version, nic, num_units, crd_channel, svr_channel, pkt_channel, range, sv_watchdog)
local self = { local self = {
sv_linked = false, sv_linked = false,
sv_addr = comms.BROADCAST, sv_addr = comms.BROADCAST,
@ -681,21 +711,16 @@ function coordinator.comms(version, nic, crd_channel, svr_channel, pkt_channel,
-- reset to disconnected before validating -- reset to disconnected before validating
iocontrol.fp_link_state(types.PANEL_LINK_STATE.DISCONNECTED) iocontrol.fp_link_state(types.PANEL_LINK_STATE.DISCONNECTED)
if type(config) == "table" and #config > 1 then if type(config) == "table" and #config == 2 then
-- get configuration -- get configuration
---@class facility_conf ---@class facility_conf
local conf = { local conf = {
num_units = config[1], ---@type integer num_units = config[1], ---@type integer
defs = {} -- boilers and turbines cooling = config[2] ---@type sv_cooling_conf
} }
if (#config - 1) == (conf.num_units * 2) then if conf.num_units == num_units then
-- record sequence of pairs of [#boilers, #turbines] per unit
for i = 2, #config do
table.insert(conf.defs, config[i])
end
-- init io controller -- init io controller
iocontrol.init(conf, public) iocontrol.init(conf, public)
@ -707,7 +732,7 @@ function coordinator.comms(version, nic, crd_channel, svr_channel, pkt_channel,
iocontrol.fp_link_state(types.PANEL_LINK_STATE.LINKED) iocontrol.fp_link_state(types.PANEL_LINK_STATE.LINKED)
else else
self.sv_config_err = true self.sv_config_err = true
log.warning("invalid supervisor configuration definitions received, establish failed") log.warning("supervisor config's number of units don't match coordinator's config, establish failed")
end end
else else
log.debug("invalid supervisor configuration table received, establish failed") log.debug("invalid supervisor configuration table received, establish failed")

222
coordinator/iocontrol.lua
View File

@ -38,9 +38,7 @@ local function __generic_ack(success) end
---@param comms_v string comms version ---@param comms_v string comms version
function iocontrol.init_fp(firmware_v, comms_v) function iocontrol.init_fp(firmware_v, comms_v)
---@class ioctl_front_panel ---@class ioctl_front_panel
io.fp = { io.fp = { ps = psil.create() }
ps = psil.create()
}
io.fp.ps.publish("version", firmware_v) io.fp.ps.publish("version", firmware_v)
io.fp.ps.publish("comms_version", comms_v) io.fp.ps.publish("comms_version", comms_v)
@ -50,9 +48,12 @@ end
---@param conf facility_conf configuration ---@param conf facility_conf configuration
---@param comms coord_comms comms reference ---@param comms coord_comms comms reference
function iocontrol.init(conf, comms) function iocontrol.init(conf, comms)
-- facility data structure
---@class ioctl_facility ---@class ioctl_facility
io.facility = { io.facility = {
num_units = conf.num_units, ---@type integer num_units = conf.num_units,
tank_mode = conf.cooling.fac_tank_mode,
tank_defs = conf.cooling.fac_tank_defs,
all_sys_ok = false, all_sys_ok = false,
rtu_count = 0, rtu_count = 0,
@ -106,6 +107,101 @@ function iocontrol.init(conf, comms)
table.insert(io.facility.sps_ps_tbl, psil.create()) table.insert(io.facility.sps_ps_tbl, psil.create())
table.insert(io.facility.sps_data_tbl, {}) table.insert(io.facility.sps_data_tbl, {})
-- determine tank information
if io.facility.tank_mode == 0 then
io.facility.tank_defs = {}
-- on facility tank mode 0, setup tank defs to match unit TANK option
for i = 1, conf.num_units do
io.facility.tank_defs[i] = util.trinary(conf.cooling.r_cool[i].TANK, 1, 0)
end
io.facility.tank_list = { table.unpack(io.facility.tank_defs) }
else
-- decode the layout of tanks from the connections definitions
local tank_mode = io.facility.tank_mode
local tank_defs = io.facility.tank_defs
local tank_list = { table.unpack(tank_defs) }
local function calc_fdef(start_idx, end_idx)
local first = 4
for i = start_idx, end_idx do
if io.facility.tank_defs[i] == 2 then
if i < first then first = i end
end
end
return first
end
if tank_mode == 1 then
-- (1) 1 total facility tank (A A A A)
local first_fdef = calc_fdef(1, #tank_defs)
for i = 1, #tank_defs do
if i > first_fdef and tank_defs[i] == 2 then
tank_list[i] = 0
end
end
elseif tank_mode == 2 then
-- (2) 2 total facility tanks (A A A B)
local first_fdef = calc_fdef(1, math.min(3, #tank_defs))
for i = 1, #tank_defs do
if (i ~= 4) and (i > first_fdef) and (tank_defs[i] == 2) then
tank_list[i] = 0
end
end
elseif tank_mode == 3 then
-- (3) 2 total facility tanks (A A B B)
for _, a in pairs({ 1, 3 }) do
local b = a + 1
if (tank_defs[a] == 2) and (tank_defs[b] == 2) then
tank_list[b] = 0
end
end
elseif tank_mode == 4 then
-- (4) 2 total facility tanks (A B B B)
local first_fdef = calc_fdef(2, #tank_defs)
for i = 1, #tank_defs do
if (i ~= 1) and (i > first_fdef) and (tank_defs[i] == 2) then
tank_list[i] = 0
end
end
elseif tank_mode == 5 then
-- (5) 3 total facility tanks (A A B C)
local first_fdef = calc_fdef(1, math.min(2, #tank_defs))
for i = 1, #tank_defs do
if (not (i == 3 or i == 4)) and (i > first_fdef) and (tank_defs[i] == 2) then
tank_list[i] = 0
end
end
elseif tank_mode == 6 then
-- (6) 3 total facility tanks (A B B C)
local first_fdef = calc_fdef(2, math.min(3, #tank_defs))
for i = 1, #tank_defs do
if (not (i == 1 or i == 4)) and (i > first_fdef) and (tank_defs[i] == 2) then
tank_list[i] = 0
end
end
elseif tank_mode == 7 then
-- (7) 3 total facility tanks (A B C C)
local first_fdef = calc_fdef(3, #tank_defs)
for i = 1, #tank_defs do
if (not (i == 1 or i == 2)) and (i > first_fdef) and (tank_defs[i] == 2) then
tank_list[i] = 0
end
end
end
io.facility.tank_list = tank_list
end
-- create facility tank tables
for i = 1, #io.facility.tank_list do
if io.facility.tank_list[i] == 2 then
table.insert(io.facility.tank_ps_tbl, psil.create())
table.insert(io.facility.tank_data_tbl, {})
end
end
-- create unit data structures
io.units = {} io.units = {}
for i = 1, conf.num_units do for i = 1, conf.num_units do
local function ack(alarm) process.ack_alarm(i, alarm) end local function ack(alarm) process.ack_alarm(i, alarm) end
@ -118,6 +214,7 @@ function iocontrol.init(conf, comms)
num_boilers = 0, num_boilers = 0,
num_turbines = 0, num_turbines = 0,
num_snas = 0, num_snas = 0,
has_tank = conf.cooling.r_cool[i].TANK,
control_state = false, control_state = false,
burn_rate_cmd = 0.0, burn_rate_cmd = 0.0,
@ -192,18 +289,27 @@ function iocontrol.init(conf, comms)
tank_data_tbl = {} tank_data_tbl = {}
} }
-- on other facility modes, overwrite unit TANK option with facility tank defs
if io.facility.tank_mode ~= 0 then
entry.has_tank = conf.cooling.fac_tank_defs[i] > 0
end
-- create boiler tables -- create boiler tables
for _ = 1, conf.defs[(i * 2) - 1] do for _ = 1, conf.cooling.r_cool[i].BOILERS do
local data = {} ---@type boilerv_session_db
table.insert(entry.boiler_ps_tbl, psil.create()) table.insert(entry.boiler_ps_tbl, psil.create())
table.insert(entry.boiler_data_tbl, data) table.insert(entry.boiler_data_tbl, {})
end end
-- create turbine tables -- create turbine tables
for _ = 1, conf.defs[i * 2] do for _ = 1, conf.cooling.r_cool[i].TURBINES do
local data = {} ---@type turbinev_session_db
table.insert(entry.turbine_ps_tbl, psil.create()) table.insert(entry.turbine_ps_tbl, psil.create())
table.insert(entry.turbine_data_tbl, data) table.insert(entry.turbine_data_tbl, {})
end
-- create tank tables
if io.facility.tank_defs[i] == 1 then
table.insert(entry.tank_ps_tbl, psil.create())
table.insert(entry.tank_data_tbl, {})
end end
entry.num_boilers = #entry.boiler_data_tbl entry.num_boilers = #entry.boiler_data_tbl
@ -234,11 +340,21 @@ function iocontrol.fp_has_speaker(has_speaker) io.fp.ps.publish("has_speaker", h
function iocontrol.fp_link_state(state) io.fp.ps.publish("link_state", state) end function iocontrol.fp_link_state(state) io.fp.ps.publish("link_state", state) end
-- report monitor connection state -- report monitor connection state
---@param id integer unit ID or 0 for main ---@param id string|integer unit ID for unit monitor, "main" for main monitor, or "flow" for flow monitor
function iocontrol.fp_monitor_state(id, connected) function iocontrol.fp_monitor_state(id, connected)
local name = "main_monitor" local name = nil
if id > 0 then name = "unit_monitor_" .. id end
if id == "main" then
name = "main_monitor"
elseif id == "flow" then
name = "flow_monitor"
elseif type(id) == "number" then
name = "unit_monitor_" .. id
end
if name ~= nil then
io.fp.ps.publish(name, connected) io.fp.ps.publish(name, connected)
end
end end
-- report PKT firmware version and PKT session connection state -- report PKT firmware version and PKT session connection state
@ -696,8 +812,7 @@ function iocontrol.update_unit_statuses(statuses)
else else
local burn_rate_sum = 0.0 local burn_rate_sum = 0.0
local sna_count_sum = 0 local sna_count_sum = 0
local pu_rate = 0.0 local pu_rate, po_rate, po_pl_rate, po_am_rate, spent_rate = 0.0, 0.0, 0.0, 0.0, 0.0
local po_rate = 0.0
-- get all unit statuses -- get all unit statuses
for i = 1, #statuses do for i = 1, #statuses do
@ -708,7 +823,7 @@ function iocontrol.update_unit_statuses(statuses)
local burn_rate = 0.0 local burn_rate = 0.0
if type(status) ~= "table" or #status ~= 5 then if type(status) ~= "table" or #status ~= 6 then
log.debug(log_header .. "invalid status entry in unit statuses (not a table or invalid length)") log.debug(log_header .. "invalid status entry in unit statuses (not a table or invalid length)")
valid = false valid = false
else else
@ -791,6 +906,8 @@ function iocontrol.update_unit_statuses(statuses)
if type(rtu_statuses) == "table" then if type(rtu_statuses) == "table" then
-- boiler statuses -- boiler statuses
if type(rtu_statuses.boilers) == "table" then if type(rtu_statuses.boilers) == "table" then
local boil_sum = 0
for id = 1, #unit.boiler_ps_tbl do for id = 1, #unit.boiler_ps_tbl do
if rtu_statuses.boilers[i] == nil then if rtu_statuses.boilers[i] == nil then
-- disconnected -- disconnected
@ -808,6 +925,8 @@ function iocontrol.update_unit_statuses(statuses)
if rtu_faulted then if rtu_faulted then
ps.publish("computed_status", 3) -- faulted ps.publish("computed_status", 3) -- faulted
elseif data.formed then elseif data.formed then
boil_sum = boil_sum + data.state.boil_rate
if data.state.boil_rate > 0 then if data.state.boil_rate > 0 then
ps.publish("computed_status", 5) -- active ps.publish("computed_status", 5) -- active
else else
@ -821,6 +940,8 @@ function iocontrol.update_unit_statuses(statuses)
valid = false valid = false
end end
end end
unit.unit_ps.publish("boiler_boil_sum", boil_sum)
else else
log.debug(log_header .. "boiler list not a table") log.debug(log_header .. "boiler list not a table")
valid = false valid = false
@ -828,6 +949,8 @@ function iocontrol.update_unit_statuses(statuses)
-- turbine statuses -- turbine statuses
if type(rtu_statuses.turbines) == "table" then if type(rtu_statuses.turbines) == "table" then
local flow_sum = 0
for id = 1, #unit.turbine_ps_tbl do for id = 1, #unit.turbine_ps_tbl do
if rtu_statuses.turbines[i] == nil then if rtu_statuses.turbines[i] == nil then
-- disconnected -- disconnected
@ -845,6 +968,8 @@ function iocontrol.update_unit_statuses(statuses)
if rtu_faulted then if rtu_faulted then
ps.publish("computed_status", 3) -- faulted ps.publish("computed_status", 3) -- faulted
elseif data.formed then elseif data.formed then
flow_sum = flow_sum + data.state.flow_rate
if data.tanks.energy_fill >= 0.99 then if data.tanks.energy_fill >= 0.99 then
ps.publish("computed_status", 6) -- trip ps.publish("computed_status", 6) -- trip
elseif data.state.flow_rate < 100 then elseif data.state.flow_rate < 100 then
@ -860,6 +985,8 @@ function iocontrol.update_unit_statuses(statuses)
valid = false valid = false
end end
end end
unit.unit_ps.publish("turbine_flow_sum", flow_sum)
else else
log.debug(log_header .. "turbine list not a table") log.debug(log_header .. "turbine list not a table")
valid = false valid = false
@ -908,8 +1035,11 @@ function iocontrol.update_unit_statuses(statuses)
if type(rtu_statuses.sna) == "table" then if type(rtu_statuses.sna) == "table" then
unit.num_snas = rtu_statuses.sna[1] ---@type integer unit.num_snas = rtu_statuses.sna[1] ---@type integer
unit.sna_prod_rate = rtu_statuses.sna[2] ---@type number unit.sna_prod_rate = rtu_statuses.sna[2] ---@type number
unit.sna_peak_rate = rtu_statuses.sna[3] ---@type number
unit.unit_ps.publish("sna_count", unit.num_snas)
unit.unit_ps.publish("sna_prod_rate", unit.sna_prod_rate) unit.unit_ps.publish("sna_prod_rate", unit.sna_prod_rate)
unit.unit_ps.publish("sna_peak_rate", unit.sna_peak_rate)
sna_count_sum = sna_count_sum + unit.num_snas sna_count_sum = sna_count_sum + unit.num_snas
else else
@ -1014,10 +1144,63 @@ function iocontrol.update_unit_statuses(statuses)
valid = false valid = false
end end
-- valve states
local valve_states = status[6]
if type(valve_states) == "table" then
if #valve_states == 5 then
unit.unit_ps.publish("V_pu_conn", valve_states[1] > 0)
unit.unit_ps.publish("V_pu_state", valve_states[1] == 2)
unit.unit_ps.publish("V_po_conn", valve_states[2] > 0)
unit.unit_ps.publish("V_po_state", valve_states[2] == 2)
unit.unit_ps.publish("V_pl_conn", valve_states[3] > 0)
unit.unit_ps.publish("V_pl_state", valve_states[3] == 2)
unit.unit_ps.publish("V_am_conn", valve_states[4] > 0)
unit.unit_ps.publish("V_am_state", valve_states[4] == 2)
unit.unit_ps.publish("V_emc_conn", valve_states[5] > 0)
unit.unit_ps.publish("V_emc_state", valve_states[5] == 2)
else
log.debug(log_header .. "valve states length mismatch")
valid = false
end
else
log.debug(log_header .. "valve states not a table")
valid = false
end
-- determine waste production for this unit, add to statistics -- determine waste production for this unit, add to statistics
local is_pu = unit.waste_product == types.WASTE_PRODUCT.PLUTONIUM local is_pu = unit.waste_product == types.WASTE_PRODUCT.PLUTONIUM
pu_rate = pu_rate + util.trinary(is_pu, burn_rate / 10.0, 0.0) local waste_rate = burn_rate / 10.0
po_rate = po_rate + util.trinary(not is_pu, math.min(burn_rate / 10.0, unit.sna_prod_rate), 0.0)
local u_spent_rate = waste_rate
local u_pu_rate = util.trinary(is_pu, waste_rate, 0.0)
local u_po_rate = util.trinary(not is_pu, math.min(waste_rate, unit.sna_prod_rate), 0.0)
unit.unit_ps.publish("pu_rate", u_pu_rate)
unit.unit_ps.publish("po_rate", u_po_rate)
unit.unit_ps.publish("sna_in", util.trinary(is_pu, 0, burn_rate))
if unit.waste_product == types.WASTE_PRODUCT.POLONIUM then
unit.unit_ps.publish("po_pl_rate", u_po_rate)
unit.unit_ps.publish("po_am_rate", 0)
po_pl_rate = po_pl_rate + u_po_rate
elseif unit.waste_product == types.WASTE_PRODUCT.ANTI_MATTER then
unit.unit_ps.publish("po_pl_rate", 0)
unit.unit_ps.publish("po_am_rate", u_po_rate)
po_am_rate = po_am_rate + u_po_rate
u_spent_rate = 0
else
unit.unit_ps.publish("po_pl_rate", 0)
unit.unit_ps.publish("po_am_rate", 0)
end
unit.unit_ps.publish("ws_rate", u_spent_rate)
pu_rate = pu_rate + u_pu_rate
po_rate = po_rate + u_po_rate
spent_rate = spent_rate + u_spent_rate
end end
end end
@ -1025,6 +1208,9 @@ function iocontrol.update_unit_statuses(statuses)
io.facility.ps.publish("sna_count", sna_count_sum) io.facility.ps.publish("sna_count", sna_count_sum)
io.facility.ps.publish("pu_rate", pu_rate) io.facility.ps.publish("pu_rate", pu_rate)
io.facility.ps.publish("po_rate", po_rate) io.facility.ps.publish("po_rate", po_rate)
io.facility.ps.publish("po_pl_rate", po_pl_rate)
io.facility.ps.publish("po_am_rate", po_am_rate)
io.facility.ps.publish("spent_waste_rate", spent_rate)
end end
return valid return valid

61
coordinator/renderer.lua
View File

@ -10,6 +10,7 @@ local iocontrol = require("coordinator.iocontrol")
local style = require("coordinator.ui.style") local style = require("coordinator.ui.style")
local pgi = require("coordinator.ui.pgi") local pgi = require("coordinator.ui.pgi")
local flow_view = require("coordinator.ui.layout.flow_view")
local panel_view = require("coordinator.ui.layout.front_panel") local panel_view = require("coordinator.ui.layout.front_panel")
local main_view = require("coordinator.ui.layout.main_view") local main_view = require("coordinator.ui.layout.main_view")
local unit_view = require("coordinator.ui.layout.unit_view") local unit_view = require("coordinator.ui.layout.unit_view")
@ -29,8 +30,10 @@ local engine = {
ui = { ui = {
front_panel = nil, ---@type graphics_element|nil front_panel = nil, ---@type graphics_element|nil
main_display = nil, ---@type graphics_element|nil main_display = nil, ---@type graphics_element|nil
flow_display = nil, ---@type graphics_element|nil
unit_displays = {} unit_displays = {}
} },
disable_flow_view = false
} }
-- init a display to the "default", but set text scale to 0.5 -- init a display to the "default", but set text scale to 0.5
@ -48,20 +51,28 @@ local function _init_display(monitor)
end end
end end
-- disable the flow view
---@param disable boolean
function renderer.legacy_disable_flow_view(disable)
engine.disable_flow_view = disable
end
-- link to the monitor peripherals -- link to the monitor peripherals
---@param monitors monitors_struct ---@param monitors monitors_struct
function renderer.set_displays(monitors) function renderer.set_displays(monitors)
engine.monitors = monitors engine.monitors = monitors
-- report to front panel as connected -- report to front panel as connected
iocontrol.fp_monitor_state(0, true) iocontrol.fp_monitor_state("main", engine.monitors.primary ~= nil)
iocontrol.fp_monitor_state("flow", engine.monitors.flow ~= nil)
for i = 1, #engine.monitors.unit_displays do iocontrol.fp_monitor_state(i, true) end for i = 1, #engine.monitors.unit_displays do iocontrol.fp_monitor_state(i, true) end
end end
-- init all displays in use by the renderer -- init all displays in use by the renderer
function renderer.init_displays() function renderer.init_displays()
-- init primary monitor -- init primary and flow monitors
_init_display(engine.monitors.primary) _init_display(engine.monitors.primary)
if not engine.disable_flow_view then _init_display(engine.monitors.flow) end
-- init unit displays -- init unit displays
for _, monitor in ipairs(engine.monitors.unit_displays) do for _, monitor in ipairs(engine.monitors.unit_displays) do
@ -88,6 +99,14 @@ function renderer.validate_main_display_width()
return w == 164 return w == 164
end end
-- check flow display width
---@nodiscard
---@return boolean width_okay
function renderer.validate_flow_display_width()
local w, _ = engine.monitors.flow.getSize()
return w == 164
end
-- check display sizes -- check display sizes
---@nodiscard ---@nodiscard
---@return boolean valid all unit display dimensions OK ---@return boolean valid all unit display dimensions OK
@ -169,6 +188,12 @@ function renderer.start_ui()
main_view(engine.ui.main_display) main_view(engine.ui.main_display)
end end
-- show flow view on flow monitor
if engine.monitors.flow ~= nil then
engine.ui.flow_display = DisplayBox{window=engine.monitors.flow,fg_bg=style.root}
flow_view(engine.ui.flow_display)
end
-- show unit views on unit displays -- show unit views on unit displays
for idx, display in pairs(engine.monitors.unit_displays) do for idx, display in pairs(engine.monitors.unit_displays) do
engine.ui.unit_displays[idx] = DisplayBox{window=display,fg_bg=style.root} engine.ui.unit_displays[idx] = DisplayBox{window=display,fg_bg=style.root}
@ -192,6 +217,7 @@ function renderer.close_ui()
-- delete element trees -- delete element trees
if engine.ui.main_display ~= nil then engine.ui.main_display.delete() end if engine.ui.main_display ~= nil then engine.ui.main_display.delete() end
if engine.ui.flow_display ~= nil then engine.ui.flow_display.delete() end
for _, display in pairs(engine.ui.unit_displays) do display.delete() end for _, display in pairs(engine.ui.unit_displays) do display.delete() end
-- report ui as not ready -- report ui as not ready
@ -199,6 +225,7 @@ function renderer.close_ui()
-- clear root UI elements -- clear root UI elements
engine.ui.main_display = nil engine.ui.main_display = nil
engine.ui.flow_display = nil
engine.ui.unit_displays = {} engine.ui.unit_displays = {}
-- clear unit monitors -- clear unit monitors
@ -236,7 +263,18 @@ function renderer.handle_disconnect(device)
engine.monitors.primary = nil engine.monitors.primary = nil
engine.ui.main_display = nil engine.ui.main_display = nil
iocontrol.fp_monitor_state(0, false) iocontrol.fp_monitor_state("main", false)
elseif engine.monitors.flow == device then
if engine.ui.flow_display ~= nil then
-- delete element tree and clear root UI elements
engine.ui.flow_display.delete()
end
is_used = true
engine.monitors.flow = nil
engine.ui.flow_display = nil
iocontrol.fp_monitor_state("flow", false)
else else
for idx, monitor in pairs(engine.monitors.unit_displays) do for idx, monitor in pairs(engine.monitors.unit_displays) do
if monitor == device then if monitor == device then
@ -284,7 +322,18 @@ function renderer.handle_reconnect(name, device)
engine.dmesg_window.redraw() engine.dmesg_window.redraw()
end end
iocontrol.fp_monitor_state(0, true) iocontrol.fp_monitor_state("main", true)
elseif engine.monitors.flow_name == name then
is_used = true
_init_display(device)
engine.monitors.flow = device
if engine.ui_ready and (engine.ui.flow_display == nil) then
engine.ui.flow_display = DisplayBox{window=device,fg_bg=style.root}
flow_view(engine.ui.flow_display)
end
iocontrol.fp_monitor_state("flow", true)
else else
for idx, monitor in ipairs(engine.monitors.unit_name_map) do for idx, monitor in ipairs(engine.monitors.unit_name_map) do
if monitor == name then if monitor == name then
@ -317,6 +366,8 @@ function renderer.handle_mouse(event)
elseif engine.ui_ready then elseif engine.ui_ready then
if event.monitor == engine.monitors.primary_name then if event.monitor == engine.monitors.primary_name then
engine.ui.main_display.handle_mouse(event) engine.ui.main_display.handle_mouse(event)
elseif event.monitor == engine.monitors.flow_name then
engine.ui.flow_display.handle_mouse(event)
else else
for id, monitor in ipairs(engine.monitors.unit_name_map) do for id, monitor in ipairs(engine.monitors.unit_name_map) do
if event.monitor == monitor then if event.monitor == monitor then

13
coordinator/startup.lua
View File

@ -22,7 +22,7 @@ local sounder = require("coordinator.sounder")
local apisessions = require("coordinator.session.apisessions") local apisessions = require("coordinator.session.apisessions")
local COORDINATOR_VERSION = "v0.22.0" local COORDINATOR_VERSION = "v1.0.0"
local println = util.println local println = util.println
local println_ts = util.println_ts local println_ts = util.println_ts
@ -84,7 +84,7 @@ local function main()
iocontrol.init_fp(COORDINATOR_VERSION, comms.version) iocontrol.init_fp(COORDINATOR_VERSION, comms.version)
-- setup monitors -- setup monitors
local configured, monitors = coordinator.configure_monitors(config.NUM_UNITS) local configured, monitors = coordinator.configure_monitors(config.NUM_UNITS, config.DISABLE_FLOW_VIEW == true)
if not configured or monitors == nil then if not configured or monitors == nil then
println("startup> monitor setup failed") println("startup> monitor setup failed")
log.fatal("monitor configuration failed") log.fatal("monitor configuration failed")
@ -92,6 +92,7 @@ local function main()
end end
-- init renderer -- init renderer
renderer.legacy_disable_flow_view(config.DISABLE_FLOW_VIEW == true)
renderer.set_displays(monitors) renderer.set_displays(monitors)
renderer.init_displays() renderer.init_displays()
@ -99,6 +100,10 @@ local function main()
println("startup> main display must be 8 blocks wide") println("startup> main display must be 8 blocks wide")
log.fatal("main display not wide enough") log.fatal("main display not wide enough")
return return
elseif (config.DISABLE_FLOW_VIEW ~= true) and not renderer.validate_flow_display_width() then
println("startup> flow display must be 8 blocks wide")
log.fatal("flow display not wide enough")
return
elseif not renderer.validate_unit_display_sizes() then elseif not renderer.validate_unit_display_sizes() then
println("startup> one or more unit display dimensions incorrect; they must be 4x4 blocks") println("startup> one or more unit display dimensions incorrect; they must be 4x4 blocks")
log.fatal("unit display dimensions incorrect") log.fatal("unit display dimensions incorrect")
@ -162,8 +167,8 @@ local function main()
-- create network interface then setup comms -- create network interface then setup comms
local nic = network.nic(modem) local nic = network.nic(modem)
local coord_comms = coordinator.comms(COORDINATOR_VERSION, nic, config.CRD_CHANNEL, config.SVR_CHANNEL, local coord_comms = coordinator.comms(COORDINATOR_VERSION, nic, config.NUM_UNITS, config.CRD_CHANNEL,
config.PKT_CHANNEL, config.TRUSTED_RANGE, conn_watchdog) config.SVR_CHANNEL, config.PKT_CHANNEL, config.TRUSTED_RANGE, conn_watchdog)
log.debug("startup> comms init") log.debug("startup> comms init")
log_comms("comms initialized") log_comms("comms initialized")

4
coordinator/ui/components/imatrix.lua
View File

@ -83,9 +83,7 @@ local function new_view(root, x, y, data, ps, id)
local function calc_saturation(val) local function calc_saturation(val)
if (type(data.build) == "table") and (type(data.build.transfer_cap) == "number") and (data.build.transfer_cap > 0) then if (type(data.build) == "table") and (type(data.build.transfer_cap) == "number") and (data.build.transfer_cap > 0) then
return val / data.build.transfer_cap return val / data.build.transfer_cap
else else return 0 end
return 0
end
end end
charge.register(ps, "energy_fill", charge.update) charge.register(ps, "energy_fill", charge.update)

53
coordinator/ui/components/process_ctl.lua
View File

@ -28,6 +28,16 @@ local TEXT_ALIGN = core.TEXT_ALIGN
local cpair = core.cpair local cpair = core.cpair
local border = core.border local border = core.border
local bw_fg_bg = style.bw_fg_bg
local lu_cpair = style.lu_colors
local hzd_fg_bg = style.hzd_fg_bg
local dis_colors = style.dis_colors
local ind_grn = style.ind_grn
local ind_yel = style.ind_yel
local ind_red = style.ind_red
local ind_wht = style.ind_wht
local period = core.flasher.PERIOD local period = core.flasher.PERIOD
-- new process control view -- new process control view
@ -40,11 +50,6 @@ local function new_view(root, x, y)
local facility = iocontrol.get_db().facility local facility = iocontrol.get_db().facility
local units = iocontrol.get_db().units local units = iocontrol.get_db().units
local bw_fg_bg = cpair(colors.black, colors.white)
local hzd_fg_bg = cpair(colors.white, colors.gray)
local lu_cpair = cpair(colors.gray, colors.gray)
local dis_colors = cpair(colors.white, colors.lightGray)
local main = Div{parent=root,width=128,height=24,x=x,y=y} local main = Div{parent=root,width=128,height=24,x=x,y=y}
local scram = HazardButton{parent=main,x=1,y=1,text="FAC SCRAM",accent=colors.yellow,dis_colors=dis_colors,callback=process.fac_scram,fg_bg=hzd_fg_bg} local scram = HazardButton{parent=main,x=1,y=1,text="FAC SCRAM",accent=colors.yellow,dis_colors=dis_colors,callback=process.fac_scram,fg_bg=hzd_fg_bg}
@ -53,10 +58,10 @@ local function new_view(root, x, y)
facility.scram_ack = scram.on_response facility.scram_ack = scram.on_response
facility.ack_alarms_ack = ack_a.on_response facility.ack_alarms_ack = ack_a.on_response
local all_ok = IndicatorLight{parent=main,y=5,label="Unit Systems Online",colors=cpair(colors.green,colors.red)} local all_ok = IndicatorLight{parent=main,y=5,label="Unit Systems Online",colors=ind_grn}
local rad_mon = TriIndicatorLight{parent=main,label="Radiation Monitor",c1=colors.gray,c2=colors.yellow,c3=colors.green} local rad_mon = TriIndicatorLight{parent=main,label="Radiation Monitor",c1=colors.gray,c2=colors.yellow,c3=colors.green}
local ind_mat = IndicatorLight{parent=main,label="Induction Matrix",colors=cpair(colors.green,colors.gray)} local ind_mat = IndicatorLight{parent=main,label="Induction Matrix",colors=ind_grn}
local sps = IndicatorLight{parent=main,label="SPS Connected",colors=cpair(colors.green,colors.gray)} local sps = IndicatorLight{parent=main,label="SPS Connected",colors=ind_grn}
all_ok.register(facility.ps, "all_sys_ok", all_ok.update) all_ok.register(facility.ps, "all_sys_ok", all_ok.update)
rad_mon.register(facility.ps, "rad_computed_status", rad_mon.update) rad_mon.register(facility.ps, "rad_computed_status", rad_mon.update)
@ -65,10 +70,10 @@ local function new_view(root, x, y)
main.line_break() main.line_break()
local auto_ready = IndicatorLight{parent=main,label="Configured Units Ready",colors=cpair(colors.green,colors.red)} local auto_ready = IndicatorLight{parent=main,label="Configured Units Ready",colors=ind_grn}
local auto_act = IndicatorLight{parent=main,label="Process Active",colors=cpair(colors.green,colors.gray)} local auto_act = IndicatorLight{parent=main,label="Process Active",colors=ind_grn}
local auto_ramp = IndicatorLight{parent=main,label="Process Ramping",colors=cpair(colors.white,colors.gray),flash=true,period=period.BLINK_250_MS} local auto_ramp = IndicatorLight{parent=main,label="Process Ramping",colors=ind_wht,flash=true,period=period.BLINK_250_MS}
local auto_sat = IndicatorLight{parent=main,label="Min/Max Burn Rate",colors=cpair(colors.yellow,colors.gray)} local auto_sat = IndicatorLight{parent=main,label="Min/Max Burn Rate",colors=ind_yel}
auto_ready.register(facility.ps, "auto_ready", auto_ready.update) auto_ready.register(facility.ps, "auto_ready", auto_ready.update)
auto_act.register(facility.ps, "auto_active", auto_act.update) auto_act.register(facility.ps, "auto_active", auto_act.update)
@ -77,12 +82,12 @@ local function new_view(root, x, y)
main.line_break() main.line_break()
local auto_scram = IndicatorLight{parent=main,label="Automatic SCRAM",colors=cpair(colors.red,colors.gray),flash=true,period=period.BLINK_250_MS} local auto_scram = IndicatorLight{parent=main,label="Automatic SCRAM",colors=ind_red,flash=true,period=period.BLINK_250_MS}
local matrix_dc = IndicatorLight{parent=main,label="Matrix Disconnected",colors=cpair(colors.yellow,colors.gray),flash=true,period=period.BLINK_500_MS} local matrix_dc = IndicatorLight{parent=main,label="Matrix Disconnected",colors=ind_yel,flash=true,period=period.BLINK_500_MS}
local matrix_fill = IndicatorLight{parent=main,label="Matrix Charge High",colors=cpair(colors.red,colors.gray),flash=true,period=period.BLINK_500_MS} local matrix_fill = IndicatorLight{parent=main,label="Matrix Charge High",colors=ind_red,flash=true,period=period.BLINK_500_MS}
local unit_crit = IndicatorLight{parent=main,label="Unit Critical Alarm",colors=cpair(colors.red,colors.gray),flash=true,period=period.BLINK_250_MS} local unit_crit = IndicatorLight{parent=main,label="Unit Critical Alarm",colors=ind_red,flash=true,period=period.BLINK_250_MS}
local fac_rad_h = IndicatorLight{parent=main,label="Facility Radiation High",colors=cpair(colors.red,colors.gray),flash=true,period=period.BLINK_250_MS} local fac_rad_h = IndicatorLight{parent=main,label="Facility Radiation High",colors=ind_red,flash=true,period=period.BLINK_250_MS}
local gen_fault = IndicatorLight{parent=main,label="Gen. Control Fault",colors=cpair(colors.yellow,colors.gray),flash=true,period=period.BLINK_500_MS} local gen_fault = IndicatorLight{parent=main,label="Gen. Control Fault",colors=ind_yel,flash=true,period=period.BLINK_500_MS}
auto_scram.register(facility.ps, "auto_scram", auto_scram.update) auto_scram.register(facility.ps, "auto_scram", auto_scram.update)
matrix_dc.register(facility.ps, "as_matrix_dc", matrix_dc.update) matrix_dc.register(facility.ps, "as_matrix_dc", matrix_dc.update)
@ -198,12 +203,12 @@ local function new_view(root, x, y)
local stat_div = Div{parent=proc,width=22,height=24,x=57,y=6} local stat_div = Div{parent=proc,width=22,height=24,x=57,y=6}
for i = 1, 4 do for i = 1, 4 do
local tag_fg_bg = cpair(colors.gray,colors.white) local tag_fg_bg = cpair(colors.gray, colors.white)
local ind_fg_bg = cpair(colors.lightGray,colors.white) local ind_fg_bg = cpair(colors.lightGray, colors.white)
local ind_off = colors.lightGray local ind_off = colors.lightGray
if i <= facility.num_units then if i <= facility.num_units then
tag_fg_bg = cpair(colors.black,colors.cyan) tag_fg_bg = cpair(colors.black, colors.cyan)
ind_fg_bg = bw_fg_bg ind_fg_bg = bw_fg_bg
ind_off = colors.gray ind_off = colors.gray
end end
@ -307,7 +312,7 @@ local function new_view(root, x, y)
local unit = units[i] ---@type ioctl_unit local unit = units[i] ---@type ioctl_unit
TextBox{parent=waste_status,y=i,text="U"..i.." Waste",width=8,height=1} TextBox{parent=waste_status,y=i,text="U"..i.." Waste",width=8,height=1}
local a_waste = IndicatorLight{parent=waste_status,x=10,y=i,label="Auto",colors=cpair(colors.white,colors.gray)} local a_waste = IndicatorLight{parent=waste_status,x=10,y=i,label="Auto",colors=ind_wht}
local waste_m = StateIndicator{parent=waste_status,x=17,y=i,states=style.waste.states_abbrv,value=1,min_width=6} local waste_m = StateIndicator{parent=waste_status,x=17,y=i,states=style.waste.states_abbrv,value=1,min_width=6}
a_waste.register(unit.unit_ps, "U_AutoWaste", a_waste.update) a_waste.register(unit.unit_ps, "U_AutoWaste", a_waste.update)
@ -330,7 +335,7 @@ local function new_view(root, x, y)
waste_prod.register(facility.ps, "process_waste_product", waste_prod.set_value) waste_prod.register(facility.ps, "process_waste_product", waste_prod.set_value)
pu_fallback.register(facility.ps, "process_pu_fallback", pu_fallback.set_value) pu_fallback.register(facility.ps, "process_pu_fallback", pu_fallback.set_value)
local fb_active = IndicatorLight{parent=rect,x=2,y=9,label="Fallback Active",colors=cpair(colors.white,colors.gray)} local fb_active = IndicatorLight{parent=rect,x=2,y=9,label="Fallback Active",colors=ind_wht}
fb_active.register(facility.ps, "pu_fallback_active", fb_active.update) fb_active.register(facility.ps, "pu_fallback_active", fb_active.update)
@ -341,7 +346,7 @@ local function new_view(root, x, y)
local po_rate = DataIndicator{parent=rect,x=2,label="",unit="mB/t",format="%12.2f",value=0,lu_colors=lu_cpair,fg_bg=bw_fg_bg,width=17} local po_rate = DataIndicator{parent=rect,x=2,label="",unit="mB/t",format="%12.2f",value=0,lu_colors=lu_cpair,fg_bg=bw_fg_bg,width=17}
TextBox{parent=rect,x=2,y=17,text="Antimatter Rate",height=1,width=17,fg_bg=style.label} TextBox{parent=rect,x=2,y=17,text="Antimatter Rate",height=1,width=17,fg_bg=style.label}
local am_rate = DataIndicator{parent=rect,x=2,label="",unit="\xb5B/t",format="%12.2f",value=0,lu_colors=lu_cpair,fg_bg=bw_fg_bg,width=17} local am_rate = DataIndicator{parent=rect,x=2,label="",unit="\xb5B/t",format="%12d",value=0,lu_colors=lu_cpair,fg_bg=bw_fg_bg,width=17}
pu_rate.register(facility.ps, "pu_rate", pu_rate.update) pu_rate.register(facility.ps, "pu_rate", pu_rate.update)
po_rate.register(facility.ps, "po_rate", po_rate.update) po_rate.register(facility.ps, "po_rate", po_rate.update)

2
coordinator/ui/components/turbine.lua
View File

@ -31,7 +31,7 @@ local function new_view(root, x, y, ps)
local flow_rate = DataIndicator{parent=turbine,x=5,y=4,lu_colors=lu_col,label="",unit="mB/t",format="%10.0f",value=0,commas=true,width=16,fg_bg=text_fg_bg} local flow_rate = DataIndicator{parent=turbine,x=5,y=4,lu_colors=lu_col,label="",unit="mB/t",format="%10.0f",value=0,commas=true,width=16,fg_bg=text_fg_bg}
status.register(ps, "computed_status", status.update) status.register(ps, "computed_status", status.update)
prod_rate.register(ps, "prod_rate", function (val) prod_rate.update(util.joules_to_fe(val)) end) prod_rate.register(ps, "steam_input_rate", function (val) prod_rate.update(util.joules_to_fe(val)) end)
flow_rate.register(ps, "flow_rate", flow_rate.update) flow_rate.register(ps, "flow_rate", flow_rate.update)
local steam = VerticalBar{parent=turbine,x=2,y=1,fg_bg=cpair(colors.white,colors.gray),height=4,width=1} local steam = VerticalBar{parent=turbine,x=2,y=1,fg_bg=cpair(colors.white,colors.gray),height=4,width=1}

105
coordinator/ui/components/unit_detail.lua
View File

@ -31,6 +31,15 @@ local TEXT_ALIGN = core.TEXT_ALIGN
local cpair = core.cpair local cpair = core.cpair
local border = core.border local border = core.border
local bw_fg_bg = style.bw_fg_bg
local lu_cpair = style.lu_colors
local hzd_fg_bg = style.hzd_fg_bg
local ind_grn = style.ind_grn
local ind_yel = style.ind_yel
local ind_red = style.ind_red
local ind_wht = style.ind_wht
local period = core.flasher.PERIOD local period = core.flasher.PERIOD
-- create a unit view -- create a unit view
@ -50,10 +59,6 @@ local function init(parent, id)
TextBox{parent=main,text="Reactor Unit #" .. id,alignment=TEXT_ALIGN.CENTER,height=1,fg_bg=style.header} TextBox{parent=main,text="Reactor Unit #" .. id,alignment=TEXT_ALIGN.CENTER,height=1,fg_bg=style.header}
local bw_fg_bg = cpair(colors.black, colors.white)
local hzd_fg_bg = cpair(colors.white, colors.gray)
local lu_cpair = cpair(colors.gray, colors.gray)
----------------------------- -----------------------------
-- main stats and core map -- -- main stats and core map --
----------------------------- -----------------------------
@ -140,7 +145,7 @@ local function init(parent, id)
-- connectivity -- connectivity
local plc_online = IndicatorLight{parent=annunciator,label="PLC Online",colors=cpair(colors.green,colors.red)} local plc_online = IndicatorLight{parent=annunciator,label="PLC Online",colors=cpair(colors.green,colors.red)}
local plc_hbeat = IndicatorLight{parent=annunciator,label="PLC Heartbeat",colors=cpair(colors.white,colors.gray)} local plc_hbeat = IndicatorLight{parent=annunciator,label="PLC Heartbeat",colors=ind_wht}
local rad_mon = TriIndicatorLight{parent=annunciator,label="Radiation Monitor",c1=colors.gray,c2=colors.yellow,c3=colors.green} local rad_mon = TriIndicatorLight{parent=annunciator,label="Radiation Monitor",c1=colors.gray,c2=colors.yellow,c3=colors.green}
plc_online.register(u_ps, "PLCOnline", plc_online.update) plc_online.register(u_ps, "PLCOnline", plc_online.update)
@ -150,25 +155,25 @@ local function init(parent, id)
annunciator.line_break() annunciator.line_break()
-- operating state -- operating state
local r_active = IndicatorLight{parent=annunciator,label="Active",colors=cpair(colors.green,colors.gray)} local r_active = IndicatorLight{parent=annunciator,label="Active",colors=ind_grn}
local r_auto = IndicatorLight{parent=annunciator,label="Automatic Control",colors=cpair(colors.white,colors.gray)} local r_auto = IndicatorLight{parent=annunciator,label="Automatic Control",colors=ind_wht}
r_active.register(u_ps, "status", r_active.update) r_active.register(u_ps, "status", r_active.update)
r_auto.register(u_ps, "AutoControl", r_auto.update) r_auto.register(u_ps, "AutoControl", r_auto.update)
-- main unit transient/warning annunciator panel -- main unit transient/warning annunciator panel
local r_scram = IndicatorLight{parent=annunciator,label="Reactor SCRAM",colors=cpair(colors.red,colors.gray)} local r_scram = IndicatorLight{parent=annunciator,label="Reactor SCRAM",colors=ind_red}
local r_mscrm = IndicatorLight{parent=annunciator,label="Manual Reactor SCRAM",colors=cpair(colors.red,colors.gray)} local r_mscrm = IndicatorLight{parent=annunciator,label="Manual Reactor SCRAM",colors=ind_red}
local r_ascrm = IndicatorLight{parent=annunciator,label="Auto Reactor SCRAM",colors=cpair(colors.red,colors.gray)} local r_ascrm = IndicatorLight{parent=annunciator,label="Auto Reactor SCRAM",colors=ind_red}
local rad_wrn = IndicatorLight{parent=annunciator,label="Radiation Warning",colors=cpair(colors.yellow,colors.gray)} local rad_wrn = IndicatorLight{parent=annunciator,label="Radiation Warning",colors=ind_yel}
local r_rtrip = IndicatorLight{parent=annunciator,label="RCP Trip",colors=cpair(colors.red,colors.gray)} local r_rtrip = IndicatorLight{parent=annunciator,label="RCP Trip",colors=ind_red}
local r_cflow = IndicatorLight{parent=annunciator,label="RCS Flow Low",colors=cpair(colors.yellow,colors.gray)} local r_cflow = IndicatorLight{parent=annunciator,label="RCS Flow Low",colors=ind_yel}
local r_clow = IndicatorLight{parent=annunciator,label="Coolant Level Low",colors=cpair(colors.yellow,colors.gray)} local r_clow = IndicatorLight{parent=annunciator,label="Coolant Level Low",colors=ind_yel}
local r_temp = IndicatorLight{parent=annunciator,label="Reactor Temp. High",colors=cpair(colors.red,colors.gray)} local r_temp = IndicatorLight{parent=annunciator,label="Reactor Temp. High",colors=ind_red}
local r_rhdt = IndicatorLight{parent=annunciator,label="Reactor High Delta T",colors=cpair(colors.yellow,colors.gray)} local r_rhdt = IndicatorLight{parent=annunciator,label="Reactor High Delta T",colors=ind_yel}
local r_firl = IndicatorLight{parent=annunciator,label="Fuel Input Rate Low",colors=cpair(colors.yellow,colors.gray)} local r_firl = IndicatorLight{parent=annunciator,label="Fuel Input Rate Low",colors=ind_yel}
local r_wloc = IndicatorLight{parent=annunciator,label="Waste Line Occlusion",colors=cpair(colors.yellow,colors.gray)} local r_wloc = IndicatorLight{parent=annunciator,label="Waste Line Occlusion",colors=ind_yel}
local r_hsrt = IndicatorLight{parent=annunciator,label="Startup Rate High",colors=cpair(colors.yellow,colors.gray)} local r_hsrt = IndicatorLight{parent=annunciator,label="Startup Rate High",colors=ind_yel}
r_scram.register(u_ps, "ReactorSCRAM", r_scram.update) r_scram.register(u_ps, "ReactorSCRAM", r_scram.update)
r_mscrm.register(u_ps, "ManualReactorSCRAM", r_mscrm.update) r_mscrm.register(u_ps, "ManualReactorSCRAM", r_mscrm.update)
@ -189,15 +194,15 @@ local function init(parent, id)
local rps = Rectangle{parent=main,border=border(1,colors.cyan,true),thin=true,width=33,height=12,x=46,y=9} local rps = Rectangle{parent=main,border=border(1,colors.cyan,true),thin=true,width=33,height=12,x=46,y=9}
local rps_annunc = Div{parent=rps,width=31,height=10,x=2,y=1} local rps_annunc = Div{parent=rps,width=31,height=10,x=2,y=1}
local rps_trp = IndicatorLight{parent=rps_annunc,label="RPS Trip",colors=cpair(colors.red,colors.gray),flash=true,period=period.BLINK_250_MS} local rps_trp = IndicatorLight{parent=rps_annunc,label="RPS Trip",colors=ind_red,flash=true,period=period.BLINK_250_MS}
local rps_dmg = IndicatorLight{parent=rps_annunc,label="Damage Level High",colors=cpair(colors.red,colors.gray),flash=true,period=period.BLINK_250_MS} local rps_dmg = IndicatorLight{parent=rps_annunc,label="Damage Level High",colors=ind_red,flash=true,period=period.BLINK_250_MS}
local rps_exh = IndicatorLight{parent=rps_annunc,label="Excess Heated Coolant",colors=cpair(colors.yellow,colors.gray)} local rps_exh = IndicatorLight{parent=rps_annunc,label="Excess Heated Coolant",colors=ind_yel}
local rps_exw = IndicatorLight{parent=rps_annunc,label="Excess Waste",colors=cpair(colors.yellow,colors.gray)} local rps_exw = IndicatorLight{parent=rps_annunc,label="Excess Waste",colors=ind_yel}
local rps_tmp = IndicatorLight{parent=rps_annunc,label="Core Temperature High",colors=cpair(colors.red,colors.gray),flash=true,period=period.BLINK_250_MS} local rps_tmp = IndicatorLight{parent=rps_annunc,label="Core Temperature High",colors=ind_red,flash=true,period=period.BLINK_250_MS}
local rps_nof = IndicatorLight{parent=rps_annunc,label="No Fuel",colors=cpair(colors.yellow,colors.gray)} local rps_nof = IndicatorLight{parent=rps_annunc,label="No Fuel",colors=ind_yel}
local rps_loc = IndicatorLight{parent=rps_annunc,label="Coolant Level Low Low",colors=cpair(colors.yellow,colors.gray)} local rps_loc = IndicatorLight{parent=rps_annunc,label="Coolant Level Low Low",colors=ind_yel}
local rps_flt = IndicatorLight{parent=rps_annunc,label="PPM Fault",colors=cpair(colors.yellow,colors.gray),flash=true,period=period.BLINK_500_MS} local rps_flt = IndicatorLight{parent=rps_annunc,label="PPM Fault",colors=ind_yel,flash=true,period=period.BLINK_500_MS}
local rps_tmo = IndicatorLight{parent=rps_annunc,label="Connection Timeout",colors=cpair(colors.yellow,colors.gray),flash=true,period=period.BLINK_500_MS} local rps_tmo = IndicatorLight{parent=rps_annunc,label="Connection Timeout",colors=ind_yel,flash=true,period=period.BLINK_500_MS}
local rps_sfl = IndicatorLight{parent=rps_annunc,label="System Failure",colors=cpair(colors.orange,colors.gray),flash=true,period=period.BLINK_500_MS} local rps_sfl = IndicatorLight{parent=rps_annunc,label="System Failure",colors=cpair(colors.orange,colors.gray),flash=true,period=period.BLINK_500_MS}
rps_trp.register(u_ps, "rps_tripped", rps_trp.update) rps_trp.register(u_ps, "rps_tripped", rps_trp.update)
@ -218,12 +223,12 @@ local function init(parent, id)
local rcs_annunc = Div{parent=rcs,width=27,height=22,x=3,y=1} local rcs_annunc = Div{parent=rcs,width=27,height=22,x=3,y=1}
local rcs_tags = Div{parent=rcs,width=2,height=16,x=1,y=7} local rcs_tags = Div{parent=rcs,width=2,height=16,x=1,y=7}
local c_flt = IndicatorLight{parent=rcs_annunc,label="RCS Hardware Fault",colors=cpair(colors.yellow,colors.gray)} local c_flt = IndicatorLight{parent=rcs_annunc,label="RCS Hardware Fault",colors=ind_yel}
local c_emg = TriIndicatorLight{parent=rcs_annunc,label="Emergency Coolant",c1=colors.gray,c2=colors.white,c3=colors.green} local c_emg = TriIndicatorLight{parent=rcs_annunc,label="Emergency Coolant",c1=colors.gray,c2=colors.white,c3=colors.green}
local c_cfm = IndicatorLight{parent=rcs_annunc,label="Coolant Feed Mismatch",colors=cpair(colors.yellow,colors.gray)} local c_cfm = IndicatorLight{parent=rcs_annunc,label="Coolant Feed Mismatch",colors=ind_yel}
local c_brm = IndicatorLight{parent=rcs_annunc,label="Boil Rate Mismatch",colors=cpair(colors.yellow,colors.gray)} local c_brm = IndicatorLight{parent=rcs_annunc,label="Boil Rate Mismatch",colors=ind_yel}
local c_sfm = IndicatorLight{parent=rcs_annunc,label="Steam Feed Mismatch",colors=cpair(colors.yellow,colors.gray)} local c_sfm = IndicatorLight{parent=rcs_annunc,label="Steam Feed Mismatch",colors=ind_yel}
local c_mwrf = IndicatorLight{parent=rcs_annunc,label="Max Water Return Feed",colors=cpair(colors.yellow,colors.gray)} local c_mwrf = IndicatorLight{parent=rcs_annunc,label="Max Water Return Feed",colors=ind_yel}
c_flt.register(u_ps, "RCSFault", c_flt.update) c_flt.register(u_ps, "RCSFault", c_flt.update)
c_emg.register(u_ps, "EmergencyCoolant", c_emg.update) c_emg.register(u_ps, "EmergencyCoolant", c_emg.update)
@ -246,11 +251,11 @@ local function init(parent, id)
if unit.num_boilers > 0 then if unit.num_boilers > 0 then
TextBox{parent=rcs_tags,x=1,text="B1",width=2,height=1,fg_bg=bw_fg_bg} TextBox{parent=rcs_tags,x=1,text="B1",width=2,height=1,fg_bg=bw_fg_bg}
local b1_wll = IndicatorLight{parent=rcs_annunc,label="Water Level Low",colors=cpair(colors.red,colors.gray)} local b1_wll = IndicatorLight{parent=rcs_annunc,label="Water Level Low",colors=ind_red}
b1_wll.register(b_ps[1], "WasterLevelLow", b1_wll.update) b1_wll.register(b_ps[1], "WasterLevelLow", b1_wll.update)
TextBox{parent=rcs_tags,text="B1",width=2,height=1,fg_bg=bw_fg_bg} TextBox{parent=rcs_tags,text="B1",width=2,height=1,fg_bg=bw_fg_bg}
local b1_hr = IndicatorLight{parent=rcs_annunc,label="Heating Rate Low",colors=cpair(colors.yellow,colors.gray)} local b1_hr = IndicatorLight{parent=rcs_annunc,label="Heating Rate Low",colors=ind_yel}
b1_hr.register(b_ps[1], "HeatingRateLow", b1_hr.update) b1_hr.register(b_ps[1], "HeatingRateLow", b1_hr.update)
end end
if unit.num_boilers > 1 then if unit.num_boilers > 1 then
@ -262,11 +267,11 @@ local function init(parent, id)
end end
TextBox{parent=rcs_tags,text="B2",width=2,height=1,fg_bg=bw_fg_bg} TextBox{parent=rcs_tags,text="B2",width=2,height=1,fg_bg=bw_fg_bg}
local b2_wll = IndicatorLight{parent=rcs_annunc,label="Water Level Low",colors=cpair(colors.red,colors.gray)} local b2_wll = IndicatorLight{parent=rcs_annunc,label="Water Level Low",colors=ind_red}
b2_wll.register(b_ps[2], "WasterLevelLow", b2_wll.update) b2_wll.register(b_ps[2], "WasterLevelLow", b2_wll.update)
TextBox{parent=rcs_tags,text="B2",width=2,height=1,fg_bg=bw_fg_bg} TextBox{parent=rcs_tags,text="B2",width=2,height=1,fg_bg=bw_fg_bg}
local b2_hr = IndicatorLight{parent=rcs_annunc,label="Heating Rate Low",colors=cpair(colors.yellow,colors.gray)} local b2_hr = IndicatorLight{parent=rcs_annunc,label="Heating Rate Low",colors=ind_yel}
b2_hr.register(b_ps[2], "HeatingRateLow", b2_hr.update) b2_hr.register(b_ps[2], "HeatingRateLow", b2_hr.update)
end end
@ -279,15 +284,15 @@ local function init(parent, id)
t1_sdo.register(t_ps[1], "SteamDumpOpen", t1_sdo.update) t1_sdo.register(t_ps[1], "SteamDumpOpen", t1_sdo.update)
TextBox{parent=rcs_tags,text="T1",width=2,height=1,fg_bg=bw_fg_bg} TextBox{parent=rcs_tags,text="T1",width=2,height=1,fg_bg=bw_fg_bg}
local t1_tos = IndicatorLight{parent=rcs_annunc,label="Turbine Over Speed",colors=cpair(colors.red,colors.gray)} local t1_tos = IndicatorLight{parent=rcs_annunc,label="Turbine Over Speed",colors=ind_red}
t1_tos.register(t_ps[1], "TurbineOverSpeed", t1_tos.update) t1_tos.register(t_ps[1], "TurbineOverSpeed", t1_tos.update)
TextBox{parent=rcs_tags,text="T1",width=2,height=1,fg_bg=bw_fg_bg} TextBox{parent=rcs_tags,text="T1",width=2,height=1,fg_bg=bw_fg_bg}
local t1_gtrp = IndicatorLight{parent=rcs_annunc,label="Generator Trip",colors=cpair(colors.yellow,colors.gray),flash=true,period=period.BLINK_250_MS} local t1_gtrp = IndicatorLight{parent=rcs_annunc,label="Generator Trip",colors=ind_yel,flash=true,period=period.BLINK_250_MS}
t1_gtrp.register(t_ps[1], "GeneratorTrip", t1_gtrp.update) t1_gtrp.register(t_ps[1], "GeneratorTrip", t1_gtrp.update)
TextBox{parent=rcs_tags,text="T1",width=2,height=1,fg_bg=bw_fg_bg} TextBox{parent=rcs_tags,text="T1",width=2,height=1,fg_bg=bw_fg_bg}
local t1_trp = IndicatorLight{parent=rcs_annunc,label="Turbine Trip",colors=cpair(colors.red,colors.gray),flash=true,period=period.BLINK_250_MS} local t1_trp = IndicatorLight{parent=rcs_annunc,label="Turbine Trip",colors=ind_red,flash=true,period=period.BLINK_250_MS}
t1_trp.register(t_ps[1], "TurbineTrip", t1_trp.update) t1_trp.register(t_ps[1], "TurbineTrip", t1_trp.update)
if unit.num_turbines > 1 then if unit.num_turbines > 1 then
@ -300,15 +305,15 @@ local function init(parent, id)
t2_sdo.register(t_ps[2], "SteamDumpOpen", t2_sdo.update) t2_sdo.register(t_ps[2], "SteamDumpOpen", t2_sdo.update)
TextBox{parent=rcs_tags,text="T2",width=2,height=1,fg_bg=bw_fg_bg} TextBox{parent=rcs_tags,text="T2",width=2,height=1,fg_bg=bw_fg_bg}
local t2_tos = IndicatorLight{parent=rcs_annunc,label="Turbine Over Speed",colors=cpair(colors.red,colors.gray)} local t2_tos = IndicatorLight{parent=rcs_annunc,label="Turbine Over Speed",colors=ind_red}
t2_tos.register(t_ps[2], "TurbineOverSpeed", t2_tos.update) t2_tos.register(t_ps[2], "TurbineOverSpeed", t2_tos.update)
TextBox{parent=rcs_tags,text="T2",width=2,height=1,fg_bg=bw_fg_bg} TextBox{parent=rcs_tags,text="T2",width=2,height=1,fg_bg=bw_fg_bg}
local t2_gtrp = IndicatorLight{parent=rcs_annunc,label="Generator Trip",colors=cpair(colors.yellow,colors.gray),flash=true,period=period.BLINK_250_MS} local t2_gtrp = IndicatorLight{parent=rcs_annunc,label="Generator Trip",colors=ind_yel,flash=true,period=period.BLINK_250_MS}
t2_gtrp.register(t_ps[2], "GeneratorTrip", t2_gtrp.update) t2_gtrp.register(t_ps[2], "GeneratorTrip", t2_gtrp.update)
TextBox{parent=rcs_tags,text="T2",width=2,height=1,fg_bg=bw_fg_bg} TextBox{parent=rcs_tags,text="T2",width=2,height=1,fg_bg=bw_fg_bg}
local t2_trp = IndicatorLight{parent=rcs_annunc,label="Turbine Trip",colors=cpair(colors.red,colors.gray),flash=true,period=period.BLINK_250_MS} local t2_trp = IndicatorLight{parent=rcs_annunc,label="Turbine Trip",colors=ind_red,flash=true,period=period.BLINK_250_MS}
t2_trp.register(t_ps[2], "TurbineTrip", t2_trp.update) t2_trp.register(t_ps[2], "TurbineTrip", t2_trp.update)
end end
@ -320,15 +325,15 @@ local function init(parent, id)
t3_sdo.register(t_ps[3], "SteamDumpOpen", t3_sdo.update) t3_sdo.register(t_ps[3], "SteamDumpOpen", t3_sdo.update)
TextBox{parent=rcs_tags,text="T3",width=2,height=1,fg_bg=bw_fg_bg} TextBox{parent=rcs_tags,text="T3",width=2,height=1,fg_bg=bw_fg_bg}
local t3_tos = IndicatorLight{parent=rcs_annunc,label="Turbine Over Speed",colors=cpair(colors.red,colors.gray)} local t3_tos = IndicatorLight{parent=rcs_annunc,label="Turbine Over Speed",colors=ind_red}
t3_tos.register(t_ps[3], "TurbineOverSpeed", t3_tos.update) t3_tos.register(t_ps[3], "TurbineOverSpeed", t3_tos.update)
TextBox{parent=rcs_tags,text="T3",width=2,height=1,fg_bg=bw_fg_bg} TextBox{parent=rcs_tags,text="T3",width=2,height=1,fg_bg=bw_fg_bg}
local t3_gtrp = IndicatorLight{parent=rcs_annunc,label="Generator Trip",colors=cpair(colors.yellow,colors.gray),flash=true,period=period.BLINK_250_MS} local t3_gtrp = IndicatorLight{parent=rcs_annunc,label="Generator Trip",colors=ind_yel,flash=true,period=period.BLINK_250_MS}
t3_gtrp.register(t_ps[3], "GeneratorTrip", t3_gtrp.update) t3_gtrp.register(t_ps[3], "GeneratorTrip", t3_gtrp.update)
TextBox{parent=rcs_tags,text="T3",width=2,height=1,fg_bg=bw_fg_bg} TextBox{parent=rcs_tags,text="T3",width=2,height=1,fg_bg=bw_fg_bg}
local t3_trp = IndicatorLight{parent=rcs_annunc,label="Turbine Trip",colors=cpair(colors.red,colors.gray),flash=true,period=period.BLINK_250_MS} local t3_trp = IndicatorLight{parent=rcs_annunc,label="Turbine Trip",colors=ind_red,flash=true,period=period.BLINK_250_MS}
t3_trp.register(t_ps[3], "TurbineTrip", t3_trp.update) t3_trp.register(t_ps[3], "TurbineTrip", t3_trp.update)
end end
@ -343,7 +348,7 @@ local function init(parent, id)
TextBox{parent=burn_control,x=9,y=2,text="mB/t"} TextBox{parent=burn_control,x=9,y=2,text="mB/t"}
local set_burn = function () unit.set_burn(burn_rate.get_value()) end local set_burn = function () unit.set_burn(burn_rate.get_value()) end
local set_burn_btn = PushButton{parent=burn_control,x=14,y=2,text="SET",min_width=5,fg_bg=cpair(colors.black,colors.yellow),active_fg_bg=cpair(colors.white,colors.gray),dis_fg_bg=dis_colors,callback=set_burn} local set_burn_btn = PushButton{parent=burn_control,x=14,y=2,text="SET",min_width=5,fg_bg=cpair(colors.black,colors.yellow),active_fg_bg=style.wh_gray,dis_fg_bg=dis_colors,callback=set_burn}
burn_rate.register(u_ps, "burn_rate", burn_rate.set_value) burn_rate.register(u_ps, "burn_rate", burn_rate.set_value)
burn_rate.register(u_ps, "max_burn", burn_rate.set_max) burn_rate.register(u_ps, "max_burn", burn_rate.set_max)
@ -475,7 +480,7 @@ local function init(parent, id)
auto_div.line_break() auto_div.line_break()
local function set_group() unit.set_group(group.get_value() - 1) end local function set_group() unit.set_group(group.get_value() - 1) end
local set_grp_btn = PushButton{parent=auto_div,text="SET",x=4,min_width=5,fg_bg=cpair(colors.black,colors.yellow),active_fg_bg=cpair(colors.white,colors.gray),dis_fg_bg=cpair(colors.gray,colors.white),callback=set_group} local set_grp_btn = PushButton{parent=auto_div,text="SET",x=4,min_width=5,fg_bg=cpair(colors.black,colors.yellow),active_fg_bg=style.wh_gray,dis_fg_bg=cpair(colors.gray,colors.white),callback=set_group}
auto_div.line_break() auto_div.line_break()
@ -486,8 +491,8 @@ local function init(parent, id)
auto_div.line_break() auto_div.line_break()
local a_rdy = IndicatorLight{parent=auto_div,label="Ready",x=2,colors=cpair(colors.green,colors.gray)} local a_rdy = IndicatorLight{parent=auto_div,label="Ready",x=2,colors=ind_grn}
local a_stb = IndicatorLight{parent=auto_div,label="Standby",x=2,colors=cpair(colors.white,colors.gray),flash=true,period=period.BLINK_1000_MS} local a_stb = IndicatorLight{parent=auto_div,label="Standby",x=2,colors=ind_wht,flash=true,period=period.BLINK_1000_MS}
a_rdy.register(u_ps, "U_AutoReady", a_rdy.update) a_rdy.register(u_ps, "U_AutoReady", a_rdy.update)

225
coordinator/ui/components/unit_flow.lua Normal file
View File

@ -0,0 +1,225 @@
--
-- Basic Unit Flow Overview
--
local util = require("scada-common.util")
local style = require("coordinator.ui.style")
local core = require("graphics.core")
local Div = require("graphics.elements.div")
local PipeNetwork = require("graphics.elements.pipenet")
local TextBox = require("graphics.elements.textbox")
local Rectangle = require("graphics.elements.rectangle")
local DataIndicator = require("graphics.elements.indicators.data")
local IndicatorLight = require("graphics.elements.indicators.light")
local TriIndicatorLight = require("graphics.elements.indicators.trilight")
local TEXT_ALIGN = core.TEXT_ALIGN
local sprintf = util.sprintf
local cpair = core.cpair
local border = core.border
local pipe = core.pipe
local wh_gray = style.wh_gray
local bw_fg_bg = style.bw_fg_bg
local text_c = style.text_colors
local lu_c = style.lu_colors
local ind_grn = style.ind_grn
local ind_wht = style.ind_wht
-- make a new unit flow window
---@param parent graphics_element parent
---@param x integer top left x
---@param y integer top left y
---@param wide boolean whether to render wide version
---@param unit ioctl_unit unit database entry
local function make(parent, x, y, wide, unit)
local height = 16
local v_start = 1 + ((unit.unit_id - 1) * 5)
local prv_start = 1 + ((unit.unit_id - 1) * 3)
local v_fields = { "pu", "po", "pl", "am" }
local v_names = {
sprintf("PV%02d-PU", v_start),
sprintf("PV%02d-PO", v_start + 1),
sprintf("PV%02d-PL", v_start + 2),
sprintf("PV%02d-AM", v_start + 3),
sprintf("PRV%02d", prv_start),
sprintf("PRV%02d", prv_start + 1),
sprintf("PRV%02d", prv_start + 2)
}
assert(parent.get_height() >= (y + height), "flow display not of sufficient vertical resolution (add an additional row of monitors) " .. y .. "," .. parent.get_height())
local function _wide(a, b) return util.trinary(wide, a, b) end
-- bounding box div
local root = Div{parent=parent,x=x,y=y,width=_wide(136, 114),height=height}
local lg_gray = cpair(colors.lightGray, colors.gray)
------------------
-- COOLING LOOP --
------------------
local reactor = Rectangle{parent=root,x=1,y=1,border=border(1,colors.gray,true),width=19,height=5,fg_bg=wh_gray}
TextBox{parent=reactor,y=1,text="FISSION REACTOR",alignment=TEXT_ALIGN.CENTER,height=1}
TextBox{parent=reactor,y=3,text="UNIT #"..unit.unit_id,alignment=TEXT_ALIGN.CENTER,height=1}
TextBox{parent=root,x=19,y=2,text="\x1b \x80 \x1a",width=1,height=3,fg_bg=lg_gray}
TextBox{parent=root,x=3,y=5,text="\x19",width=1,height=1,fg_bg=lg_gray}
local rc_pipes = {}
local emc_x = 42 -- emergency coolant connection x point
if unit.num_boilers > 0 then
table.insert(rc_pipes, pipe(0, 1, _wide(28, 19), 1, colors.lightBlue, true))
table.insert(rc_pipes, pipe(0, 3, _wide(28, 19), 3, colors.orange, true))
table.insert(rc_pipes, pipe(_wide(46 ,39), 1, _wide(72,58), 1, colors.blue, true))
table.insert(rc_pipes, pipe(_wide(46,39), 3, _wide(72,58), 3, colors.white, true))
else
emc_x = 3
table.insert(rc_pipes, pipe(0, 1, _wide(72,58), 1, colors.blue, true))
table.insert(rc_pipes, pipe(0, 3, _wide(72,58), 3, colors.white, true))
end
if unit.has_tank then
table.insert(rc_pipes, pipe(emc_x, 1, emc_x, 0, colors.blue, true, true))
end
local prv_yo = math.max(3 - unit.num_turbines, 0)
for i = 1, unit.num_turbines do
local py = 2 * (i - 1) + prv_yo
table.insert(rc_pipes, pipe(_wide(92, 78), py, _wide(104, 83), py, colors.white, true))
end
PipeNetwork{parent=root,x=20,y=1,pipes=rc_pipes,bg=colors.lightGray}
if unit.num_boilers > 0 then
local cc_rate = DataIndicator{parent=root,x=_wide(25,22),y=5,lu_colors=lu_c,label="",unit="mB/t",format="%11.0f",value=0,commas=true,width=16,fg_bg=bw_fg_bg}
local hc_rate = DataIndicator{parent=root,x=_wide(25,22),y=3,lu_colors=lu_c,label="",unit="mB/t",format="%11.0f",value=0,commas=true,width=16,fg_bg=bw_fg_bg}
cc_rate.register(unit.unit_ps, "boil_sum", cc_rate.update)
hc_rate.register(unit.unit_ps, "heating_rate", hc_rate.update)
local boiler = Rectangle{parent=root,x=_wide(47,40),y=1,border=border(1, colors.gray, true),width=19,height=5,fg_bg=wh_gray}
TextBox{parent=boiler,y=1,text="THERMO-ELECTRIC",alignment=TEXT_ALIGN.CENTER,height=1}
TextBox{parent=boiler,y=3,text="BOILERS",alignment=TEXT_ALIGN.CENTER,height=1}
TextBox{parent=root,x=_wide(47,40),y=2,text="\x1b \x80 \x1a",width=1,height=3,fg_bg=lg_gray}
TextBox{parent=root,x=_wide(65,58),y=2,text="\x1b \x80 \x1a",width=1,height=3,fg_bg=lg_gray}
local wt_rate = DataIndicator{parent=root,x=_wide(71,61),y=3,lu_colors=lu_c,label="",unit="mB/t",format="%11.0f",value=0,commas=true,width=16,fg_bg=bw_fg_bg}
local st_rate = DataIndicator{parent=root,x=_wide(71,61),y=5,lu_colors=lu_c,label="",unit="mB/t",format="%11.0f",value=0,commas=true,width=16,fg_bg=bw_fg_bg}
wt_rate.register(unit.unit_ps, "turbine_flow_sum", wt_rate.update)
st_rate.register(unit.unit_ps, "boil_sum", st_rate.update)
else
local wt_rate = DataIndicator{parent=root,x=28,y=3,lu_colors=lu_c,label="",unit="mB/t",format="%11.0f",value=0,commas=true,width=16,fg_bg=bw_fg_bg}
local st_rate = DataIndicator{parent=root,x=28,y=5,lu_colors=lu_c,label="",unit="mB/t",format="%11.0f",value=0,commas=true,width=16,fg_bg=bw_fg_bg}
wt_rate.register(unit.unit_ps, "turbine_flow_sum", wt_rate.update)
st_rate.register(unit.unit_ps, "heating_rate", st_rate.update)
end
local turbine = Rectangle{parent=root,x=_wide(93,79),y=1,border=border(1, colors.gray, true),width=19,height=5,fg_bg=wh_gray}
TextBox{parent=turbine,y=1,text="STEAM TURBINE",alignment=TEXT_ALIGN.CENTER,height=1}
TextBox{parent=turbine,y=3,text=util.trinary(unit.num_turbines>1,"GENERATORS","GENERATOR"),alignment=TEXT_ALIGN.CENTER,height=1}
TextBox{parent=root,x=_wide(93,79),y=2,text="\x1b \x80 \x1a",width=1,height=3,fg_bg=lg_gray}
for i = 1, unit.num_turbines do
local ry = 1 + (2 * (i - 1)) + prv_yo
TextBox{parent=root,x=_wide(125,103),y=ry,text="\x10\x11\x7f",fg_bg=text_c,width=3,height=1}
local state = TriIndicatorLight{parent=root,x=_wide(129,107),y=ry,label=v_names[i+4],c1=colors.gray,c2=colors.yellow,c3=colors.red}
state.register(unit.turbine_ps_tbl[i], "SteamDumpOpen", state.update)
end
----------------------
-- WASTE PROCESSING --
----------------------
local waste = Div{parent=root,x=3,y=6}
local waste_pipes = {
pipe(0, 0, _wide(19, 16), 1, colors.brown, true),
pipe(_wide(14, 13), 1, _wide(19, 17), 5, colors.brown, true),
pipe(_wide(22, 19), 1, _wide(49, 45), 1, colors.brown, true),
pipe(_wide(22, 19), 5, _wide(28, 24), 5, colors.brown, true),
pipe(_wide(64, 53), 1, _wide(95, 81), 1, colors.green, true),
pipe(_wide(48, 43), 4, _wide(71, 61), 4, colors.cyan, true),
pipe(_wide(66, 57), 4, _wide(71, 61), 8, colors.cyan, true),
pipe(_wide(74, 63), 4, _wide(95, 81), 4, colors.cyan, true),
pipe(_wide(74, 63), 8, _wide(133, 111), 8, colors.cyan, true),
pipe(_wide(108, 94), 1, _wide(132, 110), 6, colors.black, true, true),
pipe(_wide(108, 94), 4, _wide(111, 95), 1, colors.black, true, true),
pipe(_wide(132, 110), 6, _wide(130, 108), 6, colors.black, true, true)
}
PipeNetwork{parent=waste,x=1,y=1,pipes=waste_pipes,bg=colors.lightGray}
local function _valve(vx, vy, n)
TextBox{parent=waste,x=vx,y=vy,text="\x10\x11",fg_bg=text_c,width=2,height=1}
local conn = IndicatorLight{parent=waste,x=vx-3,y=vy+1,label=v_names[n],colors=ind_grn}
local open = IndicatorLight{parent=waste,x=vx-3,y=vy+2,label="OPEN",colors=ind_wht}
conn.register(unit.unit_ps, util.c("V_", v_fields[n], "_conn"), conn.update)
open.register(unit.unit_ps, util.c("V_", v_fields[n], "_state"), open.update)
end
local function _machine(mx, my, name)
local l = string.len(name) + 2
TextBox{parent=waste,x=mx,y=my,text=string.rep("\x8f",l),alignment=TEXT_ALIGN.CENTER,fg_bg=lg_gray,width=l,height=1}
TextBox{parent=waste,x=mx,y=my+1,text=name,alignment=TEXT_ALIGN.CENTER,fg_bg=wh_gray,width=l,height=1}
end
local waste_rate = DataIndicator{parent=waste,x=1,y=3,lu_colors=lu_c,label="",unit="mB/t",format="%7.2f",value=0,width=12,fg_bg=bw_fg_bg}
local pu_rate = DataIndicator{parent=waste,x=_wide(82,70),y=3,lu_colors=lu_c,label="",unit="mB/t",format="%7.3f",value=0,width=12,fg_bg=bw_fg_bg}
local po_rate = DataIndicator{parent=waste,x=_wide(52,45),y=6,lu_colors=lu_c,label="",unit="mB/t",format="%7.3f",value=0,width=12,fg_bg=bw_fg_bg}
local popl_rate = DataIndicator{parent=waste,x=_wide(82,70),y=6,lu_colors=lu_c,label="",unit="mB/t",format="%7.3f",value=0,width=12,fg_bg=bw_fg_bg}
local poam_rate = DataIndicator{parent=waste,x=_wide(82,70),y=10,lu_colors=lu_c,label="",unit="mB/t",format="%7.3f",value=0,width=12,fg_bg=bw_fg_bg}
local spent_rate = DataIndicator{parent=waste,x=_wide(117,99),y=3,lu_colors=lu_c,label="",unit="mB/t",format="%7.3f",value=0,width=12,fg_bg=bw_fg_bg}
waste_rate.register(unit.unit_ps, "act_burn_rate", waste_rate.update)
pu_rate.register(unit.unit_ps, "pu_rate", pu_rate.update)
po_rate.register(unit.unit_ps, "po_rate", po_rate.update)
popl_rate.register(unit.unit_ps, "po_pl_rate", popl_rate.update)
poam_rate.register(unit.unit_ps, "po_am_rate", poam_rate.update)
spent_rate.register(unit.unit_ps, "ws_rate", spent_rate.update)
_valve(_wide(21, 18), 2, 1)
_valve(_wide(21, 18), 6, 2)
_valve(_wide(73, 62), 5, 3)
_valve(_wide(73, 62), 9, 4)
_machine(_wide(51, 45), 1, "CENTRIFUGE \x1a");
_machine(_wide(97, 83), 1, "PRC [Pu] \x1a");
_machine(_wide(97, 83), 4, "PRC [Po] \x1a");
_machine(_wide(116, 94), 6, "SPENT WASTE \x1b")
TextBox{parent=waste,x=_wide(30,25),y=3,text="SNAs [Po]",alignment=TEXT_ALIGN.CENTER,width=19,height=1,fg_bg=wh_gray}
local sna_po = Rectangle{parent=waste,x=_wide(30,25),y=4,border=border(1,colors.gray,true),width=19,height=7,thin=true,fg_bg=bw_fg_bg}
local sna_act = IndicatorLight{parent=sna_po,label="ACTIVE",colors=ind_grn}
local sna_cnt = DataIndicator{parent=sna_po,x=12,y=1,lu_colors=lu_c,label="CNT",unit="",format="%2d",value=0,width=7}
local sna_pk = DataIndicator{parent=sna_po,y=3,lu_colors=lu_c,label="PEAK",unit="mB/t",format="%7.2f",value=0,width=17}
local sna_max = DataIndicator{parent=sna_po,lu_colors=lu_c,label="MAX",unit="mB/t",format="%8.2f",value=0,width=17}
local sna_in = DataIndicator{parent=sna_po,lu_colors=lu_c,label="IN",unit="mB/t",format="%9.2f",value=0,width=17}
sna_act.register(unit.unit_ps, "po_rate", function (r) sna_act.update(r > 0) end)
sna_cnt.register(unit.unit_ps, "sna_count", sna_cnt.update)
sna_pk.register(unit.unit_ps, "sna_peak_rate", sna_pk.update)
sna_max.register(unit.unit_ps, "sna_prod_rate", sna_max.update)
sna_in.register(unit.unit_ps, "sna_in", sna_in.update)
return root
end
return make

381
coordinator/ui/layout/flow_view.lua Normal file
View File

@ -0,0 +1,381 @@
--
-- Flow Monitor GUI
--
local types = require("scada-common.types")
local util = require("scada-common.util")
local iocontrol = require("coordinator.iocontrol")
local style = require("coordinator.ui.style")
local unit_flow = require("coordinator.ui.components.unit_flow")
local core = require("graphics.core")
local Div = require("graphics.elements.div")
local PipeNetwork = require("graphics.elements.pipenet")
local Rectangle = require("graphics.elements.rectangle")
local TextBox = require("graphics.elements.textbox")
local DataIndicator = require("graphics.elements.indicators.data")
local HorizontalBar = require("graphics.elements.indicators.hbar")
local IndicatorLight = require("graphics.elements.indicators.light")
local StateIndicator = require("graphics.elements.indicators.state")
local CONTAINER_MODE = types.CONTAINER_MODE
local TEXT_ALIGN = core.TEXT_ALIGN
local cpair = core.cpair
local border = core.border
local pipe = core.pipe
local wh_gray = style.wh_gray
local bw_fg_bg = style.bw_fg_bg
local text_col = style.text_colors
local lu_col = style.lu_colors
-- create new flow view
---@param main graphics_element main displaybox
local function init(main)
local facility = iocontrol.get_db().facility
local units = iocontrol.get_db().units
local tank_defs = facility.tank_defs
local tank_list = facility.tank_list
-- window header message
local header = TextBox{parent=main,y=1,text="Facility Coolant and Waste Flow Monitor",alignment=TEXT_ALIGN.CENTER,height=1,fg_bg=style.header}
-- max length example: "01:23:45 AM - Wednesday, September 28 2022"
local datetime = TextBox{parent=main,x=(header.get_width()-42),y=1,text="",alignment=TEXT_ALIGN.RIGHT,width=42,height=1,fg_bg=style.header}
datetime.register(facility.ps, "date_time", datetime.set_value)
local po_pipes = {}
local water_pipes = {}
-- get the y offset for this unit index
---@param idx integer unit index
local function y_ofs(idx) return ((idx - 1) * 20) end
-- determinte facility tank start/end from the definitions list
---@param start_idx integer start index of table iteration
---@param end_idx integer end index of table iteration
local function find_fdef(start_idx, end_idx)
local first, last = 4, 0
for i = start_idx, end_idx do
if tank_defs[i] == 2 then
last = i
if i < first then first = i end
end
end
return first, last
end
if facility.tank_mode == 0 or facility.tank_mode == 8 then
-- (0) tanks belong to reactor units OR (8) 4 total facility tanks (A B C D)
for i = 1, facility.num_units do
if units[i].has_tank then
local y = y_ofs(i)
table.insert(water_pipes, pipe(2, y, 2, y + 3, colors.blue, true))
table.insert(water_pipes, pipe(2, y, 21, y, colors.blue, true))
local u = units[i] ---@type ioctl_unit
local x = util.trinary(u.num_boilers == 0, 45, 84)
table.insert(water_pipes, pipe(21, y, x, y + 2, colors.blue, true, true))
end
end
else
-- setup connections for units with emergency coolant, always the same
for i = 1, #tank_defs do
if tank_defs[i] > 0 then
local y = y_ofs(i)
if tank_defs[i] == 2 then
table.insert(water_pipes, pipe(1, y, 21, y, colors.blue, true))
else
table.insert(water_pipes, pipe(2, y, 2, y + 3, colors.blue, true))
table.insert(water_pipes, pipe(2, y, 21, y, colors.blue, true))
end
local u = units[i] ---@type ioctl_unit
local x = util.trinary(u.num_boilers == 0, 45, 84)
table.insert(water_pipes, pipe(21, y, x, y + 2, colors.blue, true, true))
end
end
if facility.tank_mode == 1 then
-- (1) 1 total facility tank (A A A A)
local first_fdef, last_fdef = find_fdef(1, #tank_defs)
for i = 1, #tank_defs do
local y = y_ofs(i)
if i == first_fdef then
table.insert(water_pipes, pipe(0, y, 1, y + 5, colors.blue, true))
elseif i > first_fdef then
if i == last_fdef then
table.insert(water_pipes, pipe(0, y - 14, 0, y, colors.blue, true))
elseif i < last_fdef then
table.insert(water_pipes, pipe(0, y - 14, 0, y + 5, colors.blue, true))
end
end
end
elseif facility.tank_mode == 2 then
-- (2) 2 total facility tanks (A A A B)
local first_fdef, last_fdef = find_fdef(1, math.min(3, #tank_defs))
for i = 1, #tank_defs do
local y = y_ofs(i)
if i == 4 then
if tank_defs[i] == 2 then
table.insert(water_pipes, pipe(0, y, 1, y + 5, colors.blue, true))
end
elseif i == first_fdef then
table.insert(water_pipes, pipe(0, y, 1, y + 5, colors.blue, true))
elseif i > first_fdef then
if i == last_fdef then
table.insert(water_pipes, pipe(0, y - 14, 0, y, colors.blue, true))
elseif i < last_fdef then
table.insert(water_pipes, pipe(0, y - 14, 0, y + 5, colors.blue, true))
end
end
end
elseif facility.tank_mode == 3 then
-- (3) 2 total facility tanks (A A B B)
for _, a in pairs({ 1, 3 }) do
local b = a + 1
if tank_defs[a] == 2 then
table.insert(water_pipes, pipe(0, y_ofs(a), 1, y_ofs(a) + 6, colors.blue, true))
if tank_defs[b] == 2 then
table.insert(water_pipes, pipe(0, y_ofs(b) - 13, 1, y_ofs(b), colors.blue, true))
end
elseif tank_defs[b] == 2 then
table.insert(water_pipes, pipe(0, y_ofs(b), 1, y_ofs(b) + 6, colors.blue, true))
end
end
elseif facility.tank_mode == 4 then
-- (4) 2 total facility tanks (A B B B)
local first_fdef, last_fdef = find_fdef(2, #tank_defs)
for i = 1, #tank_defs do
local y = y_ofs(i)
if i == 1 then
if tank_defs[i] == 2 then
table.insert(water_pipes, pipe(0, y, 1, y + 5, colors.blue, true))
end
elseif i == first_fdef then
table.insert(water_pipes, pipe(0, y, 1, y + 5, colors.blue, true))
elseif i > first_fdef then
if i == last_fdef then
table.insert(water_pipes, pipe(0, y - 14, 0, y, colors.blue, true))
elseif i < last_fdef then
table.insert(water_pipes, pipe(0, y - 14, 0, y + 5, colors.blue, true))
end
end
end
elseif facility.tank_mode == 5 then
-- (5) 3 total facility tanks (A A B C)
local first_fdef, last_fdef = find_fdef(1, math.min(2, #tank_defs))
for i = 1, #tank_defs do
local y = y_ofs(i)
if i == 3 or i == 4 then
if tank_defs[i] == 2 then
table.insert(water_pipes, pipe(0, y, 1, y + 5, colors.blue, true))
end
elseif i == first_fdef then
table.insert(water_pipes, pipe(0, y, 1, y + 5, colors.blue, true))
elseif i > first_fdef then
if i == last_fdef then
table.insert(water_pipes, pipe(0, y - 14, 0, y, colors.blue, true))
elseif i < last_fdef then
table.insert(water_pipes, pipe(0, y - 14, 0, y + 5, colors.blue, true))
end
end
end
elseif facility.tank_mode == 6 then
-- (6) 3 total facility tanks (A B B C)
local first_fdef, last_fdef = find_fdef(2, math.min(3, #tank_defs))
for i = 1, #tank_defs do
local y = y_ofs(i)
if i == 1 or i == 4 then
if tank_defs[i] == 2 then
table.insert(water_pipes, pipe(0, y, 1, y + 5, colors.blue, true))
end
elseif i == first_fdef then
table.insert(water_pipes, pipe(0, y, 1, y + 5, colors.blue, true))
elseif i > first_fdef then
if i == last_fdef then
table.insert(water_pipes, pipe(0, y - 14, 0, y, colors.blue, true))
elseif i < last_fdef then
table.insert(water_pipes, pipe(0, y - 14, 0, y + 5, colors.blue, true))
end
end
end
elseif facility.tank_mode == 7 then
-- (7) 3 total facility tanks (A B C C)
local first_fdef, last_fdef = find_fdef(3, #tank_defs)
for i = 1, #tank_defs do
local y = y_ofs(i)
if i == 1 or i == 2 then
if tank_defs[i] == 2 then
table.insert(water_pipes, pipe(0, y, 1, y + 5, colors.blue, true))
end
elseif i == first_fdef then
table.insert(water_pipes, pipe(0, y, 1, y + 5, colors.blue, true))
elseif i > first_fdef then
if i == last_fdef then
table.insert(water_pipes, pipe(0, y - 14, 0, y, colors.blue, true))
elseif i < last_fdef then
table.insert(water_pipes, pipe(0, y - 14, 0, y + 5, colors.blue, true))
end
end
end
end
end
local flow_x = 3
if #water_pipes > 0 then
flow_x = 25
PipeNetwork{parent=main,x=2,y=3,pipes=water_pipes,bg=colors.lightGray}
end
for i = 1, facility.num_units do
local y_offset = y_ofs(i)
unit_flow(main, flow_x, 5 + y_offset, #water_pipes == 0, units[i])
table.insert(po_pipes, pipe(0, 3 + y_offset, 4, 0, colors.cyan, true, true))
end
PipeNetwork{parent=main,x=139,y=15,pipes=po_pipes,bg=colors.lightGray}
-----------------
-- tank valves --
-----------------
local next_f_id = 1
for i = 1, #tank_defs do
if tank_defs[i] > 0 then
local vy = 3 + y_ofs(i)
TextBox{parent=main,x=12,y=vy,text="\x10\x11",fg_bg=cpair(colors.black,colors.lightGray),width=2,height=1}
local conn = IndicatorLight{parent=main,x=9,y=vy+1,label=util.sprintf("PV%02d-EMC", i * 5),colors=style.ind_grn}
local open = IndicatorLight{parent=main,x=9,y=vy+2,label="OPEN",colors=style.ind_wht}
conn.register(units[i].unit_ps, "V_emc_conn", conn.update)
open.register(units[i].unit_ps, "V_emc_state", open.update)
end
end
-------------------
-- dynamic tanks --
-------------------
for i = 1, #tank_list do
if tank_list[i] > 0 then
local id = "U-" .. i
local f_id = next_f_id
if tank_list[i] == 2 then
id = "F-" .. next_f_id
next_f_id = next_f_id + 1
end
local y_offset = y_ofs(i)
local tank = Div{parent=main,x=3,y=7+y_offset,width=20,height=14}
TextBox{parent=tank,text=" ",height=1,x=1,y=1,fg_bg=cpair(colors.lightGray,colors.gray)}
TextBox{parent=tank,text="DYNAMIC TANK "..id,alignment=TEXT_ALIGN.CENTER,height=1,fg_bg=style.wh_gray}
local tank_box = Rectangle{parent=tank,border=border(1,colors.gray,true),width=20,height=12}
local status = StateIndicator{parent=tank_box,x=3,y=1,states=style.dtank.states,value=1,min_width=14}
TextBox{parent=tank_box,x=2,y=3,text="Fill",height=1,width=10,fg_bg=style.label}
local tank_pcnt = DataIndicator{parent=tank_box,x=10,y=3,label="",format="%5.2f",value=100,unit="%",lu_colors=lu_col,width=8,fg_bg=text_col}
local tank_amnt = DataIndicator{parent=tank_box,x=2,label="",format="%13d",value=0,unit="mB",lu_colors=lu_col,width=16,fg_bg=bw_fg_bg}
TextBox{parent=tank_box,x=2,y=6,text="Water Level",height=1,width=11,fg_bg=style.label}
local level = HorizontalBar{parent=tank_box,x=2,y=7,bar_fg_bg=cpair(colors.blue,colors.gray),height=1,width=16}
TextBox{parent=tank_box,x=2,y=9,text="In/Out Mode",height=1,width=11,fg_bg=style.label}
local can_fill = IndicatorLight{parent=tank_box,x=2,y=10,label="FILL",colors=style.ind_wht}
local can_empty = IndicatorLight{parent=tank_box,x=10,y=10,label="EMPTY",colors=style.ind_wht}
local function _can_fill(mode)
can_fill.update((mode == CONTAINER_MODE.BOTH) or (mode == CONTAINER_MODE.FILL))
end
local function _can_empty(mode)
can_empty.update((mode == CONTAINER_MODE.BOTH) or (mode == CONTAINER_MODE.EMPTY))
end
if tank_list[i] == 1 then
status.register(units[i].tank_ps_tbl[1], "computed_status", status.update)
tank_pcnt.register(units[i].tank_ps_tbl[1], "fill", function (f) tank_pcnt.update(f * 100) end)
tank_amnt.register(units[i].tank_ps_tbl[1], "stored", function (sto) tank_amnt.update(sto.amount) end)
level.register(units[i].tank_ps_tbl[1], "fill", level.update)
can_fill.register(units[i].tank_ps_tbl[1], "container_mode", _can_fill)
can_empty.register(units[i].tank_ps_tbl[1], "container_mode", _can_empty)
else
status.register(facility.tank_ps_tbl[f_id], "computed_status", status.update)
tank_pcnt.register(facility.tank_ps_tbl[f_id], "fill", function (f) tank_pcnt.update(f * 100) end)
tank_amnt.register(facility.tank_ps_tbl[f_id], "stored", function (sto) tank_amnt.update(sto.amount) end)
level.register(facility.tank_ps_tbl[f_id], "fill", level.update)
can_fill.register(facility.tank_ps_tbl[f_id], "container_mode", _can_fill)
can_empty.register(facility.tank_ps_tbl[f_id], "container_mode", _can_empty)
end
end
end
---------
-- SPS --
---------
local sps = Div{parent=main,x=140,y=3,height=12}
TextBox{parent=sps,text=" ",width=24,height=1,x=1,y=1,fg_bg=cpair(colors.lightGray,colors.gray)}
TextBox{parent=sps,text="SPS",alignment=TEXT_ALIGN.CENTER,width=24,height=1,fg_bg=wh_gray}
local sps_box = Rectangle{parent=sps,border=border(1,colors.gray,true),width=24,height=10}
local status = StateIndicator{parent=sps_box,x=5,y=1,states=style.sps.states,value=1,min_width=14}
status.register(facility.sps_ps_tbl[1], "computed_status", status.update)
TextBox{parent=sps_box,x=2,y=3,text="Input Rate",height=1,width=10,fg_bg=style.label}
local sps_in = DataIndicator{parent=sps_box,x=2,label="",format="%15.3f",value=0,unit="mB/t",lu_colors=lu_col,width=20,fg_bg=bw_fg_bg}
sps_in.register(facility.ps, "po_am_rate", sps_in.update)
TextBox{parent=sps_box,x=2,y=6,text="Production Rate",height=1,width=15,fg_bg=style.label}
local sps_rate = DataIndicator{parent=sps_box,x=2,label="",format="%15d",value=0,unit="\xb5B/t",lu_colors=lu_col,width=20,fg_bg=bw_fg_bg}
sps_rate.register(facility.sps_ps_tbl[1], "process_rate", function (r) sps_rate.update(r * 1000) end)
----------------
-- statistics --
----------------
TextBox{parent=main,x=145,y=16,text="PROC. WASTE",alignment=TEXT_ALIGN.CENTER,width=19,height=1,fg_bg=wh_gray}
local pr_waste = Rectangle{parent=main,x=145,y=17,border=border(1,colors.gray,true),width=19,height=5,thin=true,fg_bg=bw_fg_bg}
local pu = DataIndicator{parent=pr_waste,lu_colors=lu_col,label="Pu",unit="mB/t",format="%9.3f",value=0,width=17}
local po = DataIndicator{parent=pr_waste,lu_colors=lu_col,label="Po",unit="mB/t",format="%9.3f",value=0,width=17}
local popl = DataIndicator{parent=pr_waste,lu_colors=lu_col,label="PoPl",unit="mB/t",format="%7.3f",value=0,width=17}
pu.register(facility.ps, "pu_rate", pu.update)
po.register(facility.ps, "po_rate", po.update)
popl.register(facility.ps, "po_pl_rate", popl.update)
TextBox{parent=main,x=145,y=23,text="SPENT WASTE",alignment=TEXT_ALIGN.CENTER,width=19,height=1,fg_bg=wh_gray}
local sp_waste = Rectangle{parent=main,x=145,y=24,border=border(1,colors.gray,true),width=19,height=3,thin=true,fg_bg=bw_fg_bg}
local sum_sp_waste = DataIndicator{parent=sp_waste,lu_colors=lu_col,label="SUM",unit="mB/t",format="%8.3f",value=0,width=17}
sum_sp_waste.register(facility.ps, "spent_waste_rate", sum_sp_waste.update)
end
return init

3
coordinator/ui/layout/front_panel.lua
View File

@ -73,6 +73,9 @@ local function init(panel, num_units)
local main_monitor = LED{parent=monitors,label="MAIN MONITOR",colors=cpair(colors.green,colors.green_off)} local main_monitor = LED{parent=monitors,label="MAIN MONITOR",colors=cpair(colors.green,colors.green_off)}
main_monitor.register(ps, "main_monitor", main_monitor.update) main_monitor.register(ps, "main_monitor", main_monitor.update)
local flow_monitor = LED{parent=monitors,label="FLOW MONITOR",colors=cpair(colors.green,colors.green_off)}
flow_monitor.register(ps, "flow_monitor", flow_monitor.update)
monitors.line_break() monitors.line_break()
for i = 1, num_units do for i = 1, num_units do

49
coordinator/ui/style.lua
View File

@ -68,7 +68,22 @@ style.colors = {
-- { c = colors.brown, hex = 0x7f664c } -- { c = colors.brown, hex = 0x7f664c }
} }
-- MAIN LAYOUT -- -- COMMON COLOR PAIRS --
style.wh_gray = cpair(colors.white, colors.gray)
style.bw_fg_bg = cpair(colors.black, colors.white)
style.text_colors = cpair(colors.black, colors.lightGray)
style.lu_colors = cpair(colors.gray, colors.gray)
style.hzd_fg_bg = style.wh_gray
style.dis_colors = cpair(colors.white, colors.lightGray)
style.ind_grn = cpair(colors.green, colors.gray)
style.ind_yel = cpair(colors.yellow, colors.gray)
style.ind_red = cpair(colors.red, colors.gray)
style.ind_wht = style.wh_gray
-- UI COMPONENTS --
style.reactor = { style.reactor = {
-- reactor states -- reactor states
@ -206,7 +221,7 @@ style.sps = {
text = "RTU FAULT" text = "RTU FAULT"
}, },
{ {
color = cpair(colors.black, colors.gray), color = cpair(colors.white, colors.gray),
text = "IDLE" text = "IDLE"
}, },
{ {
@ -216,6 +231,36 @@ style.sps = {
} }
} }
style.dtank = {
-- dynamic tank states
states = {
{
color = cpair(colors.black, colors.yellow),
text = "OFF-LINE"
},
{
color = cpair(colors.black, colors.orange),
text = "NOT FORMED"
},
{
color = cpair(colors.black, colors.orange),
text = "RTU FAULT"
},
{
color = cpair(colors.black, colors.green),
text = "ONLINE"
},
{
color = cpair(colors.black, colors.yellow),
text = "LOW FILL"
},
{
color = cpair(colors.black, colors.green),
text = "FILLED"
},
}
}
style.waste = { style.waste = {
-- auto waste processing states -- auto waste processing states
states = { states = {

2
graphics/core.lua
View File

@ -7,7 +7,7 @@ local flasher = require("graphics.flasher")
local core = {} local core = {}
core.version = "1.1.0" core.version = "1.1.1"
core.flasher = flasher core.flasher = flasher
core.events = events core.events = events

170
graphics/elements/pipenet.lua
View File

@ -14,6 +14,12 @@ local element = require("graphics.element")
---@field y? integer auto incremented if omitted ---@field y? integer auto incremented if omitted
---@field hidden? boolean true to hide on initial draw ---@field hidden? boolean true to hide on initial draw
---@class _pipe_map_entry
---@field atr boolean align top right (or bottom left for false)
---@field thin boolean thin pipe or not
---@field fg string foreground blit
---@field bg string background blit
-- new pipe network -- new pipe network
---@param args pipenet_args ---@param args pipenet_args
---@return graphics_element element, element_id id ---@return graphics_element element, element_id id
@ -44,6 +50,14 @@ local function pipenet(args)
-- create new graphics element base object -- create new graphics element base object
local e = element.new(args) local e = element.new(args)
-- determine if there are any thin pipes involved
local any_thin = false
for p = 1, #args.pipes do
any_thin = args.pipes[p].thin
if any_thin then break end
end
if not any_thin then
-- draw all pipes -- draw all pipes
for p = 1, #args.pipes do for p = 1, #args.pipes do
local pipe = args.pipes[p] ---@type pipe local pipe = args.pipes[p] ---@type pipe
@ -54,6 +68,11 @@ local function pipenet(args)
local x_step = util.trinary(pipe.x1 >= pipe.x2, -1, 1) local x_step = util.trinary(pipe.x1 >= pipe.x2, -1, 1)
local y_step = util.trinary(pipe.y1 >= pipe.y2, -1, 1) local y_step = util.trinary(pipe.y1 >= pipe.y2, -1, 1)
if pipe.thin then
x_step = util.trinary(pipe.x1 == pipe.x2, 0, x_step)
y_step = util.trinary(pipe.y1 == pipe.y2, 0, y_step)
end
e.window.setCursorPos(x, y) e.window.setCursorPos(x, y)
local c = core.cpair(pipe.color, e.fg_bg.bkg) local c = core.cpair(pipe.color, e.fg_bg.bkg)
@ -106,8 +125,10 @@ local function pipenet(args)
-- corner -- corner
if y_step < 0 then if y_step < 0 then
e.window.blit("\x97", c.blit_bkg, c.blit_fgd) e.window.blit("\x97", c.blit_bkg, c.blit_fgd)
else elseif y_step > 0 then
e.window.blit("\x8d", c.blit_fgd, c.blit_bkg) e.window.blit("\x8d", c.blit_fgd, c.blit_bkg)
else
e.window.blit("\x8c", c.blit_fgd, c.blit_bkg)
end end
else else
e.window.blit("\x95", c.blit_fgd, c.blit_bkg) e.window.blit("\x95", c.blit_fgd, c.blit_bkg)
@ -139,7 +160,154 @@ local function pipenet(args)
end end
end end
end end
end
else
-- build map if using thin pipes, easist way to check adjacent blocks (cannot 'cheat' like with standard width)
local map = {}
-- allocate map
for x = 1, args.width do
table.insert(map, {})
for _ = 1, args.height do table.insert(map[x], false) end
end
-- build map
for p = 1, #args.pipes do
local pipe = args.pipes[p] ---@type pipe
local x = 1 + pipe.x1
local y = 1 + pipe.y1
local x_step = util.trinary(pipe.x1 >= pipe.x2, -1, 1)
local y_step = util.trinary(pipe.y1 >= pipe.y2, -1, 1)
local entry = { atr = pipe.align_tr, thin = pipe.thin, fg = colors.toBlit(pipe.color), bg = e.fg_bg.blit_bkg }
if pipe.align_tr then
-- cross width then height
for _ = 1, pipe.w do
map[x][y] = entry
x = x + x_step
end
x = x - x_step -- back up one
for _ = 1, pipe.h do
map[x][y] = entry
y = y + y_step
end
else
-- cross height then width
for _ = 1, pipe.h do
map[x][y] = entry
y = y + y_step
end
y = y - y_step -- back up one
for _ = 1, pipe.w do
map[x][y] = entry
x = x + x_step
end
end
end
-- render
for x = 1, args.width do
for y = 1, args.height do
local entry = map[x][y] ---@type _pipe_map_entry|false
local char
local invert = false
if entry ~= false then
local function check(cx, cy)
return (map[cx] ~= nil) and (map[cx][cy] ~= nil) and (map[cx][cy] ~= false) and (map[cx][cy].fg == entry.fg)
end
if entry.thin then
if check(x - 1, y) then -- if left
if check(x, y - 1) then -- if above
if check(x + 1, y) then -- if right
if check(x, y + 1) then -- if below
char = util.trinary(entry.atr, "\x91", "\x9d")
invert = entry.atr
else -- not below
char = util.trinary(entry.atr, "\x8e", "\x8d")
end
else -- not right
if check(x, y + 1) then -- if below
char = util.trinary(entry.atr, "\x91", "\x95")
invert = entry.atr
else -- not below
char = util.trinary(entry.atr, "\x8e", "\x85")
end
end
elseif check(x, y + 1) then-- not above, if below
if check(x + 1, y) then -- if right
char = util.trinary(entry.atr, "\x93", "\x9c")
invert = entry.atr
else -- not right
char = util.trinary(entry.atr, "\x93", "\x94")
invert = entry.atr
end
else -- not above, not below
char = "\x8c"
end
elseif check(x + 1, y) then -- not left, if right
if check(x, y - 1) then -- if above
if check(x, y + 1) then -- if below
char = util.trinary(entry.atr, "\x95", "\x9d")
invert = entry.atr
else -- not below
char = util.trinary(entry.atr, "\x8a", "\x8d")
end
else -- not above
if check(x, y + 1) then -- if below
char = util.trinary(entry.atr, "\x97", "\x9c")
invert = entry.atr
else -- not below
char = "\x8c"
end
end
else -- not left, not right
char = "\x95"
invert = entry.atr
end
else
if check(x, y - 1) then -- above
-- not below and (if left or right)
if (not check(x, y + 1)) and (check(x - 1, y) or check(x + 1, y)) then
char = util.trinary(entry.atr, "\x8f", " ")
invert = not entry.atr
else -- not below w/ sides only
char = " "
invert = true
end
elseif check(x, y + 1) then -- not above, if below
-- if left or right
if (check(x - 1, y) or check(x + 1, y)) then
char = "\x83"
invert = true
else -- not left or right
char = " "
invert = true
end
else -- not above, not below
char = util.trinary(entry.atr, "\x8f", "\x83")
invert = not entry.atr
end
end
e.window.setCursorPos(x, y)
if invert then
e.window.blit(char, entry.bg, entry.fg)
else
e.window.blit(char, entry.fg, entry.bg)
end
end
end
end
end end
return e.complete() return e.complete()

30
supervisor/config.lua
View File

@ -10,27 +10,39 @@ config.RTU_CHANNEL = 16242
config.CRD_CHANNEL = 16243 config.CRD_CHANNEL = 16243
-- pocket comms channel -- pocket comms channel
config.PKT_CHANNEL = 16244 config.PKT_CHANNEL = 16244
-- max trusted modem message distance (0 to disable check) -- max trusted modem message distance
-- (0 to disable check)
config.TRUSTED_RANGE = 0 config.TRUSTED_RANGE = 0
-- time in seconds (>= 2) before assuming a remote device is no longer active -- time in seconds (>= 2) before assuming a remote
-- device is no longer active
config.PLC_TIMEOUT = 5 config.PLC_TIMEOUT = 5
config.RTU_TIMEOUT = 5 config.RTU_TIMEOUT = 5
config.CRD_TIMEOUT = 5 config.CRD_TIMEOUT = 5
config.PKT_TIMEOUT = 5 config.PKT_TIMEOUT = 5
-- facility authentication key (do NOT use one of your passwords) -- facility authentication key
-- (do NOT use one of your passwords)
-- this enables verifying that messages are authentic -- this enables verifying that messages are authentic
-- all devices on the same network must use the same key -- all devices on this network must use this key
-- config.AUTH_KEY = "SCADAfacility123" -- config.AUTH_KEY = "SCADAfacility123"
-- expected number of reactors -- expected number of reactors
config.NUM_REACTORS = 4 config.NUM_REACTORS = 4
-- expected number of boilers/turbines for each reactor -- expected number of devices for each unit
config.REACTOR_COOLING = { config.REACTOR_COOLING = {
{ BOILERS = 1, TURBINES = 1 }, -- reactor unit 1 -- reactor unit 1
{ BOILERS = 1, TURBINES = 1 }, -- reactor unit 2 { BOILERS = 1, TURBINES = 1, TANK = false },
{ BOILERS = 1, TURBINES = 1 }, -- reactor unit 3 -- reactor unit 2
{ BOILERS = 1, TURBINES = 1 } -- reactor unit 4 { BOILERS = 1, TURBINES = 1, TANK = false },
-- reactor unit 3
{ BOILERS = 1, TURBINES = 1, TANK = false },
-- reactor unit 4
{ BOILERS = 1, TURBINES = 1, TANK = false }
} }
-- advanced facility dynamic tank configuration
-- (see wiki for details)
-- by default, dynamic tanks are for each unit
config.FAC_TANK_MODE = 0
config.FAC_TANK_DEFS = { 0, 0, 0, 0 }
-- log path -- log path
config.LOG_PATH = "/log.txt" config.LOG_PATH = "/log.txt"

42
supervisor/facility.lua
View File

@ -7,6 +7,8 @@ local util = require("scada-common.util")
local unit = require("supervisor.unit") local unit = require("supervisor.unit")
local qtypes = require("supervisor.session.rtu.qtypes")
local rsctl = require("supervisor.session.rsctl") local rsctl = require("supervisor.session.rsctl")
local TONE = audio.TONE local TONE = audio.TONE
@ -14,6 +16,7 @@ local TONE = audio.TONE
local ALARM = types.ALARM local ALARM = types.ALARM
local PRIO = types.ALARM_PRIORITY local PRIO = types.ALARM_PRIORITY
local ALARM_STATE = types.ALARM_STATE local ALARM_STATE = types.ALARM_STATE
local CONTAINER_MODE = types.CONTAINER_MODE
local PROCESS = types.PROCESS local PROCESS = types.PROCESS
local PROCESS_NAMES = types.PROCESS_NAMES local PROCESS_NAMES = types.PROCESS_NAMES
local RTU_UNIT_TYPE = types.RTU_UNIT_TYPE local RTU_UNIT_TYPE = types.RTU_UNIT_TYPE
@ -22,6 +25,8 @@ local WASTE = types.WASTE_PRODUCT
local IO = rsio.IO local IO = rsio.IO
local DTV_RTU_S_DATA = qtypes.DTV_RTU_S_DATA
-- 7.14 kJ per blade for 1 mB of fissile fuel<br> -- 7.14 kJ per blade for 1 mB of fissile fuel<br>
-- 2856 FE per blade per 1 mB, 285.6 FE per blade per 0.1 mB (minimum) -- 2856 FE per blade per 1 mB, 285.6 FE per blade per 0.1 mB (minimum)
local POWER_PER_BLADE = util.joules_to_fe(7140) local POWER_PER_BLADE = util.joules_to_fe(7140)
@ -59,7 +64,7 @@ local facility = {}
-- create a new facility management object -- create a new facility management object
---@nodiscard ---@nodiscard
---@param num_reactors integer number of reactor units ---@param num_reactors integer number of reactor units
---@param cooling_conf table cooling configurations of reactor units ---@param cooling_conf sv_cooling_conf cooling configurations of reactor units
function facility.new(num_reactors, cooling_conf) function facility.new(num_reactors, cooling_conf)
local self = { local self = {
units = {}, units = {},
@ -130,7 +135,7 @@ function facility.new(num_reactors, cooling_conf)
-- create units -- create units
for i = 1, num_reactors do for i = 1, num_reactors do
table.insert(self.units, unit.new(i, cooling_conf[i].BOILERS, cooling_conf[i].TURBINES)) table.insert(self.units, unit.new(i, cooling_conf.r_cool[i].BOILERS, cooling_conf.r_cool[i].TURBINES))
table.insert(self.group_map, 0) table.insert(self.group_map, 0)
end end
@ -756,25 +761,48 @@ function facility.new(num_reactors, cooling_conf)
self.io_ctl.digital_write(IO.F_ALARM, has_alarm) self.io_ctl.digital_write(IO.F_ALARM, has_alarm)
end end
----------------------------- ----------------
-- Update Waste Processing -- -- Unit Tasks --
----------------------------- ----------------
local insufficent_po_rate = false local insufficent_po_rate = false
local need_emcool = false
for i = 1, #self.units do for i = 1, #self.units do
local u = self.units[i] ---@type reactor_unit local u = self.units[i] ---@type reactor_unit
-- update auto waste processing
if u.get_control_inf().waste_mode == WASTE_MODE.AUTO then if u.get_control_inf().waste_mode == WASTE_MODE.AUTO then
if (u.get_sna_rate() * 10.0) < u.get_burn_rate() then if (u.get_sna_rate() * 10.0) < u.get_burn_rate() then
insufficent_po_rate = true insufficent_po_rate = true
break
end
end end
end end
-- check if unit activated emergency coolant & uses facility tanks
if (cooling_conf.fac_tank_mode > 0) and u.is_emer_cool_tripped() and (cooling_conf.fac_tank_defs[i] == 2) then
need_emcool = true
end
end
-- update waste product
if self.waste_product == WASTE.PLUTONIUM or (self.pu_fallback and insufficent_po_rate) then if self.waste_product == WASTE.PLUTONIUM or (self.pu_fallback and insufficent_po_rate) then
self.current_waste_product = WASTE.PLUTONIUM self.current_waste_product = WASTE.PLUTONIUM
else self.current_waste_product = self.waste_product end else self.current_waste_product = self.waste_product end
-- make sure dynamic tanks are allowing outflow if required
-- set all, rather than trying to determine which is for which (simpler & safer)
-- there should be no need for any to be in fill only mode
if need_emcool then
for i = 1, #self.tanks do
local session = self.tanks[i] ---@type unit_session
local tank = session.get_db() ---@type dynamicv_session_db
if tank.state.container_mode == CONTAINER_MODE.FILL then
session.get_cmd_queue().push_data(DTV_RTU_S_DATA.SET_CONT_MODE, CONTAINER_MODE.BOTH)
end
end
end
------------------------ ------------------------
-- Update Alarm Tones -- -- Update Alarm Tones --
------------------------ ------------------------

17
supervisor/session/coordinator.lua
View File

@ -17,6 +17,9 @@ local FAC_COMMAND = comms.FAC_COMMAND
local SV_Q_DATA = svqtypes.SV_Q_DATA local SV_Q_DATA = svqtypes.SV_Q_DATA
-- grace period in seconds for coordinator to finish UI draw to prevent timeout
local WATCHDOG_GRACE = 20.0
-- retry time constants in ms -- retry time constants in ms
-- local INITIAL_WAIT = 1500 -- local INITIAL_WAIT = 1500
local RETRY_PERIOD = 1000 local RETRY_PERIOD = 1000
@ -61,6 +64,7 @@ function coordinator.new_session(id, s_addr, in_queue, out_queue, timeout, facil
r_seq_num = nil, r_seq_num = nil,
connected = true, connected = true,
conn_watchdog = util.new_watchdog(timeout), conn_watchdog = util.new_watchdog(timeout),
establish_time = util.time_s(),
last_rtt = 0, last_rtt = 0,
-- periodic messages -- periodic messages
periodics = { periodics = {
@ -169,7 +173,8 @@ function coordinator.new_session(id, s_addr, in_queue, out_queue, timeout, facil
unit.get_rtu_statuses(), unit.get_rtu_statuses(),
unit.get_annunciator(), unit.get_annunciator(),
unit.get_alarms(), unit.get_alarms(),
unit.get_state() unit.get_state(),
unit.get_valves()
} }
end end
@ -355,7 +360,15 @@ function coordinator.new_session(id, s_addr, in_queue, out_queue, timeout, facil
-- check if a timer matches this session's watchdog -- check if a timer matches this session's watchdog
---@nodiscard ---@nodiscard
function public.check_wd(timer) function public.check_wd(timer)
return self.conn_watchdog.is_timer(timer) and self.connected local is_wd = self.conn_watchdog.is_timer(timer) and self.connected
-- if we are waiting for initial coordinator UI draw, don't close yet
if is_wd and (util.time_s() - self.establish_time) <= WATCHDOG_GRACE then
self.conn_watchdog.feed()
is_wd = false
end
return is_wd
end end
-- close the connection -- close the connection

12
supervisor/session/rsctl.lua
View File

@ -11,6 +11,18 @@ function rsctl.new(redstone_rtus)
---@class rs_controller ---@class rs_controller
local public = {} local public = {}
-- check if a redstone port has available connections
---@param port IO_PORT
---@return boolean
function public.is_connected(port)
for i = 1, #redstone_rtus do
local db = redstone_rtus[i].get_db() ---@type redstone_session_db
if db.io[port] ~= nil then return true end
end
return false
end
-- write to a digital redstone port (applies to all RTUs) -- write to a digital redstone port (applies to all RTUs)
---@param port IO_PORT ---@param port IO_PORT
---@param value boolean ---@param value boolean

2
supervisor/session/svsessions.lua
View File

@ -198,7 +198,7 @@ end
---@param nic nic network interface device ---@param nic nic network interface device
---@param fp_ok boolean front panel active ---@param fp_ok boolean front panel active
---@param num_reactors integer number of reactors ---@param num_reactors integer number of reactors
---@param cooling_conf table cooling configuration definition ---@param cooling_conf sv_cooling_conf cooling configuration definition
function svsessions.init(nic, fp_ok, num_reactors, cooling_conf) function svsessions.init(nic, fp_ok, num_reactors, cooling_conf)
self.nic = nic self.nic = nic
self.fp_ok = fp_ok self.fp_ok = fp_ok

8
supervisor/startup.lua
View File

@ -21,7 +21,7 @@ local supervisor = require("supervisor.supervisor")
local svsessions = require("supervisor.session.svsessions") local svsessions = require("supervisor.session.svsessions")
local SUPERVISOR_VERSION = "v0.22.1" local SUPERVISOR_VERSION = "v1.0.0"
local println = util.println local println = util.println
local println_ts = util.println_ts local println_ts = util.println_ts
@ -48,11 +48,16 @@ cfv.assert_type_num(config.PKT_TIMEOUT)
cfv.assert_min(config.PKT_TIMEOUT, 2) cfv.assert_min(config.PKT_TIMEOUT, 2)
cfv.assert_type_int(config.NUM_REACTORS) cfv.assert_type_int(config.NUM_REACTORS)
cfv.assert_type_table(config.REACTOR_COOLING) cfv.assert_type_table(config.REACTOR_COOLING)
cfv.assert_type_int(config.FAC_TANK_MODE)
cfv.assert_type_table(config.FAC_TANK_DEFS)
cfv.assert_type_str(config.LOG_PATH) cfv.assert_type_str(config.LOG_PATH)
cfv.assert_type_int(config.LOG_MODE) cfv.assert_type_int(config.LOG_MODE)
assert(cfv.valid(), "bad config file: missing/invalid fields") assert(cfv.valid(), "bad config file: missing/invalid fields")
assert((config.FAC_TANK_MODE == 0) or (config.NUM_REACTORS == #config.FAC_TANK_DEFS),
"bad config file: FAC_TANK_DEFS length not equal to NUM_REACTORS")
cfv.assert_eq(#config.REACTOR_COOLING, config.NUM_REACTORS) cfv.assert_eq(#config.REACTOR_COOLING, config.NUM_REACTORS)
assert(cfv.valid(), "config: number of cooling configs different than number of units") assert(cfv.valid(), "config: number of cooling configs different than number of units")
@ -61,6 +66,7 @@ for i = 1, config.NUM_REACTORS do
assert(cfv.valid(), "config: missing cooling entry for reactor " .. i) assert(cfv.valid(), "config: missing cooling entry for reactor " .. i)
cfv.assert_type_int(config.REACTOR_COOLING[i].BOILERS) cfv.assert_type_int(config.REACTOR_COOLING[i].BOILERS)
cfv.assert_type_int(config.REACTOR_COOLING[i].TURBINES) cfv.assert_type_int(config.REACTOR_COOLING[i].TURBINES)
cfv.assert_type_bool(config.REACTOR_COOLING[i].TANK)
assert(cfv.valid(), "config: missing boilers/turbines for reactor " .. i) assert(cfv.valid(), "config: missing boilers/turbines for reactor " .. i)
cfv.assert_min(config.REACTOR_COOLING[i].BOILERS, 0) cfv.assert_min(config.REACTOR_COOLING[i].BOILERS, 0)
cfv.assert_min(config.REACTOR_COOLING[i].TURBINES, 1) cfv.assert_min(config.REACTOR_COOLING[i].TURBINES, 1)

11
supervisor/supervisor.lua
View File

@ -32,7 +32,8 @@ function supervisor.comms(_version, nic, fp_ok)
-- configuration data -- configuration data
local num_reactors = config.NUM_REACTORS local num_reactors = config.NUM_REACTORS
local cooling_conf = config.REACTOR_COOLING ---@class sv_cooling_conf
local cooling_conf = { r_cool = config.REACTOR_COOLING, fac_tank_mode = config.FAC_TANK_MODE, fac_tank_defs = config.FAC_TANK_DEFS }
local self = { local self = {
last_est_acks = {} last_est_acks = {}
@ -295,16 +296,10 @@ function supervisor.comms(_version, nic, fp_ok)
local s_id = svsessions.establish_crd_session(src_addr, firmware_v) local s_id = svsessions.establish_crd_session(src_addr, firmware_v)
if s_id ~= false then if s_id ~= false then
local cfg = { num_reactors }
for i = 1, #cooling_conf do
table.insert(cfg, cooling_conf[i].BOILERS)
table.insert(cfg, cooling_conf[i].TURBINES)
end
println(util.c("CRD (", firmware_v, ") [@", src_addr, "] \xbb connected")) println(util.c("CRD (", firmware_v, ") [@", src_addr, "] \xbb connected"))
log.info(util.c("CRD_ESTABLISH: coordinator (", firmware_v, ") [@", src_addr, "] connected with session ID ", s_id)) log.info(util.c("CRD_ESTABLISH: coordinator (", firmware_v, ") [@", src_addr, "] connected with session ID ", s_id))
_send_establish(packet.scada_frame, ESTABLISH_ACK.ALLOW, cfg) _send_establish(packet.scada_frame, ESTABLISH_ACK.ALLOW, { num_reactors, cooling_conf })
else else
if last_ack ~= ESTABLISH_ACK.COLLISION then if last_ack ~= ESTABLISH_ACK.COLLISION then
log.info("CRD_ESTABLISH: denied new coordinator [@" .. src_addr .. "] due to already being connected to another coordinator") log.info("CRD_ESTABLISH: denied new coordinator [@" .. src_addr .. "] due to already being connected to another coordinator")

50
supervisor/unit.lua
View File

@ -333,14 +333,28 @@ function unit.new(reactor_id, num_boilers, num_turbines)
--#region redstone I/O --#region redstone I/O
local __rs_w = self.io_ctl.digital_write -- create a generic valve interface
---@nodiscard
---@param port IO_PORT
local function _make_valve_iface(port)
---@class unit_valve_iface
local iface = {
open = function () self.io_ctl.digital_write(port, true) end,
close = function () self.io_ctl.digital_write(port, false) end,
-- check valve state
---@nodiscard
---@return 0|1|2 0 for not connected, 1 for inactive, 2 for active
check = function () return util.trinary(self.io_ctl.is_connected(port), util.trinary(self.io_ctl.digital_read(port), 2, 1), 0) end
}
return iface
end
-- valves -- valves
local waste_pu = { open = function () __rs_w(IO.WASTE_PU, true) end, close = function () __rs_w(IO.WASTE_PU, false) end } local waste_pu = _make_valve_iface(IO.WASTE_PU)
local waste_sna = { open = function () __rs_w(IO.WASTE_PO, true) end, close = function () __rs_w(IO.WASTE_PO, false) end } local waste_sna = _make_valve_iface(IO.WASTE_PO)
local waste_po = { open = function () __rs_w(IO.WASTE_POPL, true) end, close = function () __rs_w(IO.WASTE_POPL, false) end } local waste_po = _make_valve_iface(IO.WASTE_POPL)
local waste_sps = { open = function () __rs_w(IO.WASTE_AM, true) end, close = function () __rs_w(IO.WASTE_AM, false) end } local waste_sps = _make_valve_iface(IO.WASTE_AM)
local emer_cool = { open = function () __rs_w(IO.U_EMER_COOL, true) end, close = function () __rs_w(IO.U_EMER_COOL, false) end } local emer_cool = _make_valve_iface(IO.U_EMER_COOL)
---@class unit_valves ---@class unit_valves
self.valves = { self.valves = {
@ -736,6 +750,10 @@ function unit.new(reactor_id, num_boilers, num_turbines)
return true return true
end end
-- check if emergency coolant activation has been tripped
---@nodiscard
function public.is_emer_cool_tripped() return self.emcool_opened end
-- get build properties of machines -- get build properties of machines
-- --
-- filter options -- filter options
@ -830,7 +848,12 @@ function unit.new(reactor_id, num_boilers, num_turbines)
end end
-- basic SNA statistical information -- basic SNA statistical information
status.sna = { #self.snas, public.get_sna_rate() } local total_peak = 0
for i = 1, #self.snas do
local db = self.snas[i].get_db() ---@type sna_session_db
total_peak = total_peak + db.state.peak_production
end
status.sna = { #self.snas, public.get_sna_rate(), total_peak }
-- radiation monitors (environment detectors) -- radiation monitors (environment detectors)
status.rad_mon = {} status.rad_mon = {}
@ -881,6 +904,19 @@ function unit.new(reactor_id, num_boilers, num_turbines)
} }
end end
-- get valve states
---@nodiscard
function public.get_valves()
local v = self.valves
return {
v.waste_pu.check(),
v.waste_sna.check(),
v.waste_po.check(),
v.waste_sps.check(),
v.emer_cool.check()
}
end
-- get the reactor ID -- get the reactor ID
---@nodiscard ---@nodiscard
function public.get_id() return self.r_id end function public.get_id() return self.r_id end

12
supervisor/unitlogic.lua
View File

@ -10,11 +10,13 @@ local qtypes = require("supervisor.session.rtu.qtypes")
local RPS_TRIP_CAUSE = types.RPS_TRIP_CAUSE local RPS_TRIP_CAUSE = types.RPS_TRIP_CAUSE
local TRI_FAIL = types.TRI_FAIL local TRI_FAIL = types.TRI_FAIL
local CONTAINER_MODE = types.CONTAINER_MODE
local DUMPING_MODE = types.DUMPING_MODE local DUMPING_MODE = types.DUMPING_MODE
local PRIO = types.ALARM_PRIORITY local PRIO = types.ALARM_PRIORITY
local ALARM_STATE = types.ALARM_STATE local ALARM_STATE = types.ALARM_STATE
local TBV_RTU_S_DATA = qtypes.TBV_RTU_S_DATA local TBV_RTU_S_DATA = qtypes.TBV_RTU_S_DATA
local DTV_RTU_S_DATA = qtypes.DTV_RTU_S_DATA
local IO = rsio.IO local IO = rsio.IO
@ -826,6 +828,16 @@ function logic.handle_redstone(self)
end end
end end
-- make sure dynamic tanks are allowing outflow
for i = 1, #self.tanks do
local session = self.tanks[i] ---@type unit_session
local tank = session.get_db() ---@type dynamicv_session_db
if tank.state.container_mode == CONTAINER_MODE.FILL then
session.get_cmd_queue().push_data(DTV_RTU_S_DATA.SET_CONT_MODE, CONTAINER_MODE.BOTH)
end
end
if self.db.annunciator.EmergencyCoolant > 1 and not self.emcool_opened then if self.db.annunciator.EmergencyCoolant > 1 and not self.emcool_opened then
log.info(util.c("UNIT ", self.r_id, " emergency coolant valve opened")) log.info(util.c("UNIT ", self.r_id, " emergency coolant valve opened"))
log.info(util.c("UNIT ", self.r_id, " turbines set to dump excess steam")) log.info(util.c("UNIT ", self.r_id, " turbines set to dump excess steam"))