Merge branch 'zesterer/rtsim-tweaks' into 'master'

Started adding wandering rtsim monsters

See merge request veloren/veloren!3908

assets/common/entity/wild/aggressive/cyclops.ron

@@ -0,0 +1,11 @@
+#![enable(implicit_some)]
+(
+    name: Automatic,
+    body: RandomWith("cyclops"),
+    alignment: Alignment(Enemy),
+    loot: LootTable("common.loot_tables.dungeon.tier-4.miniboss"),
+    inventory: (
+        loadout: FromBody,
+    ),
+    meta: [],
+)

assets/common/entity/wild/aggressive/werewolf.ron

@@ -0,0 +1,11 @@
+#![enable(implicit_some)]
+(
+    name: Automatic,
+    body: RandomWith("werewolf"),
+    alignment: Alignment(Enemy),
+    loot: LootTable("common.loot_tables.creature.biped_large.default"),
+    inventory: (
+        loadout: FromBody,
+    ),
+    meta: [],
+)

assets/voxygen/i18n/en/body.ftl

@@ -0,0 +1,11 @@
+body-generic = creature
+body-biped_large-ogre = ogre
+body-biped_large-cyclops = cyclops
+body-biped_large-wendigo = wendigo
+body-biped_large-werewolf = werewolf
+body-biped_large-cave_troll = cave troll
+body-biped_large-mountain_troll = mountain troll
+body-biped_large-swamp_troll = swamp troll
+body-biped_large-blue_oni = blue oni
+body-biped_large-red_oni = red oni
+body-biped_large-tursus = tursus

assets/voxygen/i18n/en/npc.ftl

@@ -253,7 +253,11 @@ npc-speech-merchant_sell_directed =
 npc-speech-tell_site =
     .a0 = Have you visited { $site }? It's just { $dir } of here!
     .a1 = You should visit { $site } some time.
-    .a2 = If you travel { $dir }, you can get to { $site }.
+    .a2 = If you travel { $dist } to the { $dir }, you can get to { $site }.
+    .a3 = To the { $dir } you'll find { $site }, it's { $dist }.
+npc-speech-tell_monster =
+    .a0 = They say there's a { $body } to the { $dir }, { $dist }...
+    .a1 = You think you're tough? To the { $dir } there's a { $body }.
 npc-speech-witness_murder =
     .a0 = Murderer!
     .a1 = How could you do this?
@@ -274,3 +278,9 @@ npc-speech-dir_south = south
 npc-speech-dir_south_west = south-west
 npc-speech-dir_west = west
 npc-speech-dir_north_west = north-west
+
+npc-speech-dist_very_far = very far away
+npc-speech-dist_far = far away
+npc-speech-dist_ahead = some way away
+npc-speech-dist_near = nearby
+npc-speech-dist_near_to = very close

assets/voxygen/shaders/include/light.glsl

@@ -199,7 +199,7 @@ float lights_at(vec3 wpos, vec3 wnorm, vec3 /*cam_to_frag*/view_dir, vec3 mu, ve
         float computed_shadow = ShadowCalculationPoint(i, -difference, wnorm, wpos/*, light_distance*/);
         // directed_light += is_direct ? max(computed_shadow, /*LIGHT_AMBIANCE*/0.0) * direct_light : vec3(0.0);
         // Non-physically emulate ambient light nearby
-        float ambiance = (dot(-wnorm, direct_light_dir) * 0.5 + 0.5) * strength;
+        float ambiance = mix(0.05, 0.5, (dot(wnorm, direct_light_dir) + 1.0) * 0.5) * strength;
         #ifdef FIGURE_SHADER
             // Non-physical hack. Subtle, but allows lanterns to glow nicely
             // TODO: Make lanterns use glowing cells instead

client/src/lib.rs

@@ -23,6 +23,7 @@ use common::{
         self,
         chat::KillSource,
         controller::CraftEvent,
+        dialogue::Subject,
         group,
         inventory::item::{modular, tool, ItemKind},
         invite::{InviteKind, InviteResponse},
@@ -1132,14 +1133,16 @@ impl Client {
         }
     }
 
-    pub fn npc_interact(&mut self, npc_entity: EcsEntity) {
+    pub fn npc_interact(&mut self, npc_entity: EcsEntity, subject: Subject) {
         // If we're dead, exit before sending message
         if self.is_dead() {
             return;
         }
 
         if let Some(uid) = self.state.read_component_copied(npc_entity) {
-            self.send_msg(ClientGeneral::ControlEvent(ControlEvent::Interact(uid)));
+            self.send_msg(ClientGeneral::ControlEvent(ControlEvent::Interact(
+                uid, subject,
+            )));
         }
     }
 

common/src/comp/agent.rs

@@ -4,7 +4,7 @@ use crate::{
         quadruped_small, ship, Body, UtteranceKind,
     },
     path::Chaser,
-    rtsim::RtSimController,
+    rtsim::{NpcInput, RtSimController},
     trade::{PendingTrade, ReducedInventory, SiteId, SitePrices, TradeId, TradeResult},
     uid::Uid,
 };
@@ -569,6 +569,8 @@ pub struct Agent {
     /// required and reset each time the flee timer is reset.
     pub flee_from_pos: Option<Pos>,
     pub awareness: Awareness,
+    /// Inputs sent up to rtsim
+    pub rtsim_outbox: Option<VecDeque<NpcInput>>,
 }
 
 #[derive(Clone, Debug)]
@@ -673,6 +675,7 @@ impl Agent {
             position_pid_controller: None,
             flee_from_pos: None,
             awareness: Awareness::new(0.0),
+            rtsim_outbox: None,
         }
     }
 

common/src/comp/body.rs

@@ -18,6 +18,7 @@ pub mod theropod;
 
 use crate::{
     assets::{self, Asset},
+    comp::Content,
     consts::{HUMAN_DENSITY, WATER_DENSITY},
     make_case_elim,
     npc::NpcKind,
@@ -1076,6 +1077,13 @@ impl Body {
         }
         .into()
     }
+
+    pub fn localize(&self) -> Content {
+        match self {
+            Self::BipedLarge(biped_large) => biped_large.localize(),
+            _ => Content::localized("body-generic"),
+        }
+    }
 }
 
 impl Component for Body {

common/src/comp/body/biped_large.rs

@@ -1,4 +1,4 @@
-use crate::{make_case_elim, make_proj_elim};
+use crate::{comp::Content, make_case_elim, make_proj_elim};
 use rand::{seq::SliceRandom, thread_rng};
 use serde::{Deserialize, Serialize};
 
@@ -23,6 +23,22 @@ impl Body {
         let body_type = *ALL_BODY_TYPES.choose(rng).unwrap();
         Self { species, body_type }
     }
+
+    pub fn localize(&self) -> Content {
+        Content::localized(match &self.species {
+            Species::Ogre => "body-biped_large-ogre",
+            Species::Cyclops => "body-biped_large-cyclops",
+            Species::Wendigo => "body-biped_large-wendigo",
+            Species::Werewolf => "body-biped_large-werewolf",
+            Species::Cavetroll => "body-biped_large-cave_troll",
+            Species::Mountaintroll => "body-biped_large-mountain_troll",
+            Species::Swamptroll => "body-biped_large-swamp_troll",
+            Species::Blueoni => "body-biped_large-blue_oni",
+            Species::Redoni => "body-biped_large-red_oni",
+            Species::Tursus => "body-biped_large-tursus",
+            _ => "body-generic",
+        })
+    }
 }
 
 impl From<Body> for super::Body {

common/src/comp/compass.rs

@@ -102,4 +102,14 @@ impl Distance {
             Distance::NextTo => "just around",
         }
     }
+
+    pub fn localize_npc(&self) -> Content {
+        Content::localized(match self {
+            Self::VeryFar => "npc-speech-dist_very_far",
+            Self::Far => "npc-speech-dist_far",
+            Self::Ahead => "npc-speech-dist_ahead",
+            Self::Near => "npc-speech-dist_near",
+            Self::NextTo => "npc-speech-dist_near_to",
+        })
+    }
 }

common/src/comp/controller.rs

@@ -1,6 +1,7 @@
 use crate::{
     comp::{
         ability,
+        dialogue::Subject,
         inventory::{
             item::tool::ToolKind,
             slot::{EquipSlot, InvSlotId, Slot},
@@ -137,7 +138,7 @@ pub enum ControlEvent {
     //ToggleLantern,
     EnableLantern,
     DisableLantern,
-    Interact(Uid),
+    Interact(Uid, Subject),
     InitiateInvite(Uid, InviteKind),
     InviteResponse(InviteResponse),
     PerformTradeAction(TradeId, TradeAction),

common/src/comp/dialogue.rs

@@ -1,23 +1,24 @@
+use serde::{Deserialize, Serialize};
 use vek::{Vec2, Vec3};
 
 use super::Item;
 
-#[derive(Clone, Debug)]
+#[derive(Clone, Debug, PartialEq, Eq, Serialize, Deserialize)]
 pub struct AskedLocation {
     pub name: String,
     pub origin: Vec2<i32>,
 }
 
-#[derive(Clone, Debug)]
+#[derive(Clone, Debug, PartialEq, Eq, Serialize, Deserialize)]
 pub enum PersonType {
     Merchant,
     Villager { name: String },
 }
 
-#[derive(Clone, Debug)]
+#[derive(Clone, Debug, PartialEq, Eq, Serialize, Deserialize)]
 pub struct AskedPerson {
     pub person_type: PersonType,
-    pub origin: Option<Vec3<f32>>,
+    pub origin: Option<Vec3<i32>>,
 }
 
 impl AskedPerson {
@@ -30,7 +31,7 @@ impl AskedPerson {
 }
 
 /// Conversation subject
-#[derive(Clone, Debug)]
+#[derive(Clone, Debug, PartialEq, Eq, Serialize, Deserialize)]
 pub enum Subject {
     /// Using simple interaction with NPC
     /// This is meant to be the default behavior of talking

common/src/comp/presence.rs

@@ -40,6 +40,14 @@ impl PresenceKind {
     /// certain in-game messages from the client such as control inputs
     /// should be handled.
     pub fn controlling_char(&self) -> bool { matches!(self, Self::Character(_) | Self::Possessor) }
+
+    pub fn character_id(&self) -> Option<CharacterId> {
+        if let Self::Character(character_id) = self {
+            Some(*character_id)
+        } else {
+            None
+        }
+    }
 }
 
 #[derive(PartialEq, Debug, Clone, Copy)]

common/src/event.rs

@@ -3,6 +3,7 @@ use crate::{
     comp::{
         self,
         agent::Sound,
+        dialogue::Subject,
         invite::{InviteKind, InviteResponse},
         DisconnectReason, Ori, Pos,
     },
@@ -189,7 +190,7 @@ pub enum ServerEvent {
     },
     EnableLantern(EcsEntity),
     DisableLantern(EcsEntity),
-    NpcInteract(EcsEntity, EcsEntity),
+    NpcInteract(EcsEntity, EcsEntity, Subject),
     InviteResponse(EcsEntity, InviteResponse),
     InitiateInvite(EcsEntity, Uid, InviteKind),
     ProcessTradeAction(EcsEntity, TradeId, TradeAction),

common/src/rtsim.rs

@@ -3,7 +3,10 @@
 // `Agent`). When possible, this should be moved to the `rtsim`
 // module in `server`.
 
-use crate::{character::CharacterId, comp::Content};
+use crate::{
+    character::CharacterId,
+    comp::{dialogue::Subject, Content},
+};
 use rand::{seq::IteratorRandom, Rng};
 use serde::{Deserialize, Serialize};
 use specs::Component;
@@ -19,6 +22,8 @@ slotmap::new_key_type! { pub struct SiteId; }
 
 slotmap::new_key_type! { pub struct FactionId; }
 
+slotmap::new_key_type! { pub struct ReportId; }
+
 #[derive(Copy, Clone, Debug)]
 pub struct RtSimEntity(pub NpcId);
 
@@ -258,6 +263,13 @@ pub enum NpcAction {
     Attack(Actor),
 }
 
+// Represents a message passed back to rtsim from an agent's brain
+#[derive(Clone, Debug)]
+pub enum NpcInput {
+    Report(ReportId),
+    Interaction(Actor, Subject),
+}
+
 // Note: the `serde(name = "...")` is to minimise the length of field
 // identifiers for the sake of rtsim persistence
 #[derive(Copy, Clone, Debug, Serialize, Deserialize, PartialEq, Eq, enum_map::Enum)]
@@ -286,6 +298,18 @@ pub enum ChunkResource {
     Ore, // Iron, copper, etc.
 }
 
+// Note: the `serde(name = "...")` is to minimise the length of field
+// identifiers for the sake of rtsim persistence
+#[derive(Clone, Debug, Serialize, Deserialize)]
+pub enum Role {
+    #[serde(rename = "0")]
+    Civilised(Option<Profession>),
+    #[serde(rename = "1")]
+    Wild,
+    #[serde(rename = "2")]
+    Monster,
+}
+
 // Note: the `serde(name = "...")` is to minimise the length of field
 // identifiers for the sake of rtsim persistence
 #[derive(Clone, Debug, Serialize, Deserialize)]

common/src/terrain/mod.rs

@@ -80,6 +80,7 @@ impl TerrainChunkSize {
 pub trait CoordinateConversions {
     fn wpos_to_cpos(&self) -> Self;
     fn cpos_to_wpos(&self) -> Self;
+    fn cpos_to_wpos_center(&self) -> Self;
 }
 
 impl CoordinateConversions for Vec2<i32> {
@@ -90,6 +91,13 @@ impl CoordinateConversions for Vec2<i32> {
 
     #[inline]
     fn cpos_to_wpos(&self) -> Self { self.map2(TerrainChunkSize::RECT_SIZE, |e, sz| e * sz as i32) }
+
+    #[inline]
+    fn cpos_to_wpos_center(&self) -> Self {
+        self.map2(TerrainChunkSize::RECT_SIZE, |e, sz| {
+            e * sz as i32 + sz as i32 / 2
+        })
+    }
 }
 
 impl CoordinateConversions for Vec2<f32> {
@@ -98,6 +106,13 @@ impl CoordinateConversions for Vec2<f32> {
 
     #[inline]
     fn cpos_to_wpos(&self) -> Self { self.map2(TerrainChunkSize::RECT_SIZE, |e, sz| e * sz as f32) }
+
+    #[inline]
+    fn cpos_to_wpos_center(&self) -> Self {
+        self.map2(TerrainChunkSize::RECT_SIZE, |e, sz| {
+            e * sz as f32 + sz as f32 / 2.0
+        })
+    }
 }
 
 impl CoordinateConversions for Vec2<f64> {
@@ -106,6 +121,13 @@ impl CoordinateConversions for Vec2<f64> {
 
     #[inline]
     fn cpos_to_wpos(&self) -> Self { self.map2(TerrainChunkSize::RECT_SIZE, |e, sz| e * sz as f64) }
+
+    #[inline]
+    fn cpos_to_wpos_center(&self) -> Self {
+        self.map2(TerrainChunkSize::RECT_SIZE, |e, sz| {
+            e * sz as f64 + sz as f64 / 2.0
+        })
+    }
 }
 
 // TerrainChunkMeta

common/systems/src/controller.rs

@@ -66,12 +66,13 @@ impl<'a> System<'a> for Sys {
                     ControlEvent::DisableLantern => {
                         server_emitter.emit(ServerEvent::DisableLantern(entity))
                     },
-                    ControlEvent::Interact(npc_uid) => {
+                    ControlEvent::Interact(npc_uid, subject) => {
                         if let Some(npc_entity) = read_data
                             .uid_allocator
                             .retrieve_entity_internal(npc_uid.id())
                         {
-                            server_emitter.emit(ServerEvent::NpcInteract(entity, npc_entity));
+                            server_emitter
+                                .emit(ServerEvent::NpcInteract(entity, npc_entity, subject));
                         }
                     },
                     ControlEvent::InitiateInvite(inviter_uid, kind) => {

rtsim/src/ai/mod.rs

@@ -5,8 +5,12 @@ use crate::{
     },
     RtState,
 };
-use common::resources::{Time, TimeOfDay};
+use common::{
+    resources::{Time, TimeOfDay},
+    rtsim::NpcInput,
+};
 use hashbrown::HashSet;
+use itertools::Either;
 use rand_chacha::ChaChaRng;
 use std::{any::Any, collections::VecDeque, marker::PhantomData, ops::ControlFlow};
 use world::{IndexRef, World};
@@ -25,7 +29,7 @@ pub struct NpcCtx<'a> {
     pub npc_id: NpcId,
     pub npc: &'a Npc,
     pub controller: &'a mut Controller,
-    pub inbox: &'a mut VecDeque<ReportId>, // TODO: Allow more inbox items
+    pub inbox: &'a mut VecDeque<NpcInput>, // TODO: Allow more inbox items
     pub sentiments: &'a mut Sentiments,
     pub known_reports: &'a mut HashSet<ReportId>,
 
@@ -227,6 +231,22 @@ pub trait Action<R = ()>: Any + Send + Sync {
     {
         Debug(self, mk_info, PhantomData)
     }
+
+    #[must_use]
+    fn l<Rhs>(self) -> Either<Self, Rhs>
+    where
+        Self: Sized,
+    {
+        Either::Left(self)
+    }
+
+    #[must_use]
+    fn r<Lhs>(self) -> Either<Lhs, Self>
+    where
+        Self: Sized,
+    {
+        Either::Right(self)
+    }
 }
 
 impl<R: 'static> Action<R> for Box<dyn Action<R>> {
@@ -246,11 +266,11 @@ impl<R: 'static> Action<R> for Box<dyn Action<R>> {
     fn tick(&mut self, ctx: &mut NpcCtx) -> ControlFlow<R> { (**self).tick(ctx) }
 }
 
-impl<R: 'static, A: Action<R>, B: Action<R>> Action<R> for itertools::Either<A, B> {
+impl<R: 'static, A: Action<R>, B: Action<R>> Action<R> for Either<A, B> {
     fn is_same(&self, other: &Self) -> bool {
         match (self, other) {
-            (itertools::Either::Left(x), itertools::Either::Left(y)) => x.is_same(y),
+            (Either::Left(x), Either::Left(y)) => x.is_same(y),
-            (itertools::Either::Right(x), itertools::Either::Right(y)) => x.is_same(y),
+            (Either::Right(x), Either::Right(y)) => x.is_same(y),
             _ => false,
         }
     }
@@ -259,22 +279,22 @@ impl<R: 'static, A: Action<R>, B: Action<R>> Action<R> for itertools::Either<A,
 
     fn backtrace(&self, bt: &mut Vec<String>) {
         match self {
-            itertools::Either::Left(x) => x.backtrace(bt),
+            Either::Left(x) => x.backtrace(bt),
-            itertools::Either::Right(x) => x.backtrace(bt),
+            Either::Right(x) => x.backtrace(bt),
         }
     }
 
     fn reset(&mut self) {
         match self {
-            itertools::Either::Left(x) => x.reset(),
+            Either::Left(x) => x.reset(),
-            itertools::Either::Right(x) => x.reset(),
+            Either::Right(x) => x.reset(),
         }
     }
 
     fn tick(&mut self, ctx: &mut NpcCtx) -> ControlFlow<R> {
         match self {
-            itertools::Either::Left(x) => x.tick(ctx),
+            Either::Left(x) => x.tick(ctx),
-            itertools::Either::Right(x) => x.tick(ctx),
+            Either::Right(x) => x.tick(ctx),
         }
     }
 }

rtsim/src/data/npc.rs

@@ -1,6 +1,6 @@
 use crate::{
     ai::Action,
-    data::{ReportId, Reports, Sentiments},
+    data::{Reports, Sentiments},
     gen::name,
 };
 pub use common::rtsim::{NpcId, Profession};
@@ -9,7 +9,8 @@ use common::{
     comp,
     grid::Grid,
     rtsim::{
-        Actor, ChunkResource, FactionId, NpcAction, NpcActivity, Personality, SiteId, VehicleId,
+        Actor, ChunkResource, FactionId, NpcAction, NpcActivity, NpcInput, Personality, ReportId,
+        Role, SiteId, VehicleId,
     },
     store::Id,
     terrain::CoordinateConversions,
@@ -96,7 +97,7 @@ pub struct Npc {
     pub wpos: Vec3<f32>,
 
     pub body: comp::Body,
-    pub profession: Option<Profession>,
+    pub role: Role,
     pub home: Option<SiteId>,
     pub faction: Option<FactionId>,
     pub riding: Option<Riding>,
@@ -120,7 +121,7 @@ pub struct Npc {
     #[serde(skip)]
     pub controller: Controller,
     #[serde(skip)]
-    pub inbox: VecDeque<ReportId>,
+    pub inbox: VecDeque<NpcInput>,
 
     /// Whether the NPC is in simulated or loaded mode (when rtsim is run on the
     /// server, loaded corresponds to being within a loaded chunk). When in
@@ -138,7 +139,7 @@ impl Clone for Npc {
         Self {
             seed: self.seed,
             wpos: self.wpos,
-            profession: self.profession.clone(),
+            role: self.role.clone(),
             home: self.home,
             faction: self.faction,
             riding: self.riding.clone(),
@@ -162,14 +163,14 @@ impl Npc {
     pub const PERM_ENTITY_CONFIG: u32 = 1;
     const PERM_NAME: u32 = 0;
 
-    pub fn new(seed: u32, wpos: Vec3<f32>, body: comp::Body) -> Self {
+    pub fn new(seed: u32, wpos: Vec3<f32>, body: comp::Body, role: Role) -> Self {
         Self {
             seed,
             wpos,
             body,
             personality: Default::default(),
             sentiments: Default::default(),
-            profession: None,
+            role,
             home: None,
             faction: None,
             riding: None,
@@ -190,11 +191,15 @@ impl Npc {
         self
     }
 
-    // TODO: have a dedicated `NpcBuilder` type for this.
+    // // TODO: have a dedicated `NpcBuilder` type for this.
-    pub fn with_profession(mut self, profession: impl Into<Option<Profession>>) -> Self {
+    // pub fn with_profession(mut self, profession: impl Into<Option<Profession>>)
-        self.profession = profession.into();
+    // -> Self {     if let Role::Humanoid(p) = &mut self.role {
-        self
+    //         *p = profession.into();
-    }
+    //     } else {
+    //         panic!("Tried to assign profession {:?} to NPC, but has role {:?},
+    // which cannot have a profession", profession.into(), self.role);     }
+    //     self
+    // }
 
     // TODO: have a dedicated `NpcBuilder` type for this.
     pub fn with_home(mut self, home: impl Into<Option<SiteId>>) -> Self {
@@ -232,6 +237,13 @@ impl Npc {
     // once we've decided that we want to
     pub fn get_name(&self) -> String { name::generate(&mut self.rng(Self::PERM_NAME)) }
 
+    pub fn profession(&self) -> Option<Profession> {
+        match &self.role {
+            Role::Civilised(profession) => profession.clone(),
+            Role::Monster | Role::Wild => None,
+        }
+    }
+
     pub fn cleanup(&mut self, reports: &Reports) {
         // Clear old or superfluous sentiments
         // TODO: It might be worth giving more important NPCs a higher sentiment

rtsim/src/data/report.rs

@@ -4,7 +4,7 @@ use slotmap::HopSlotMap;
 use std::ops::Deref;
 use vek::*;
 
-slotmap::new_key_type! { pub struct ReportId; }
+pub use common::rtsim::ReportId;
 
 /// Represents a single piece of information known by an rtsim entity.
 ///

rtsim/src/gen/mod.rs

@@ -12,14 +12,14 @@ use common::{
     comp::{self, Body},
     grid::Grid,
     resources::TimeOfDay,
-    rtsim::{Personality, WorldSettings},
+    rtsim::{Personality, Role, WorldSettings},
-    terrain::TerrainChunkSize,
+    terrain::{BiomeKind, CoordinateConversions, TerrainChunkSize},
     vol::RectVolSize,
 };
 use rand::prelude::*;
 use tracing::info;
 use vek::*;
-use world::{site::SiteKind, site2::PlotKind, IndexRef, World};
+use world::{site::SiteKind, site2::PlotKind, IndexRef, World, CONFIG};
 
 impl Data {
     pub fn generate(settings: &WorldSettings, world: &World, index: IndexRef) -> Self {
@@ -124,11 +124,7 @@ impl Data {
                             rng.gen(),
                             rand_wpos(&mut rng, matches_buildings),
                             random_humanoid(&mut rng),
-                        )
+                            Role::Civilised(Some(match rng.gen_range(0..20) {
-                        .with_faction(site.faction)
-                        .with_home(site_id)
-                        .with_personality(Personality::random(&mut rng))
-                        .with_profession(match rng.gen_range(0..20) {
                                 0 => Profession::Hunter,
                                 1 => Profession::Blacksmith,
                                 2 => Profession::Chef,
@@ -137,7 +133,11 @@ impl Data {
                                 9..=10 => Profession::Herbalist,
                                 11..=16 => Profession::Guard,
                                 _ => Profession::Adventurer(rng.gen_range(0..=3)),
-                        }),
+                            })),
+                        )
+                        .with_faction(site.faction)
+                        .with_home(site_id)
+                        .with_personality(Personality::random(&mut rng)),
                     );
                 }
             } else {
@@ -147,11 +147,11 @@ impl Data {
                             rng.gen(),
                             rand_wpos(&mut rng, matches_buildings),
                             random_humanoid(&mut rng),
+                            Role::Civilised(Some(Profession::Cultist)),
                         )
                         .with_personality(Personality::random_evil(&mut rng))
                         .with_faction(site.faction)
-                        .with_home(site_id)
+                        .with_home(site_id),
-                        .with_profession(Profession::Cultist),
                     );
                 }
             }
@@ -163,10 +163,10 @@ impl Data {
                             rng.gen(),
                             rand_wpos(&mut rng, matches_plazas),
                             random_humanoid(&mut rng),
+                            Role::Civilised(Some(Profession::Merchant)),
                         )
                         .with_home(site_id)
-                        .with_personality(Personality::random_good(&mut rng))
+                        .with_personality(Personality::random_good(&mut rng)),
-                        .with_profession(Profession::Merchant),
                     );
                 }
             }
@@ -178,9 +178,13 @@ impl Data {
                     .create_vehicle(Vehicle::new(wpos, comp::body::ship::Body::DefaultAirship));
 
                 this.npcs.create_npc(
-                    Npc::new(rng.gen(), wpos, random_humanoid(&mut rng))
+                    Npc::new(
+                        rng.gen(),
+                        wpos,
+                        random_humanoid(&mut rng),
+                        Role::Civilised(Some(Profession::Captain)),
+                    )
                     .with_home(site_id)
-                        .with_profession(Profession::Captain)
                     .with_personality(Personality::random_good(&mut rng))
                     .steering(vehicle_id),
                 );
@@ -211,10 +215,56 @@ impl Data {
                     rng.gen(),
                     rand_wpos(&mut rng),
                     Body::BirdLarge(comp::body::bird_large::Body::random_with(&mut rng, species)),
+                    Role::Wild,
                 )
                 .with_home(site_id),
             );
         }
+
+        // Spawn monsters into the world
+        for _ in 0..100 {
+            // Try a few times to find a location that's not underwater
+            if let Some((wpos, chunk)) = (0..10)
+                .map(|_| world.sim().get_size().map(|sz| rng.gen_range(0..sz as i32)))
+                .find_map(|pos| Some((pos, world.sim().get(pos).filter(|c| !c.is_underwater())?)))
+                .map(|(pos, chunk)| {
+                    let wpos2d = pos.cpos_to_wpos_center();
+                    (
+                        wpos2d
+                            .map(|e| e as f32 + 0.5)
+                            .with_z(world.sim().get_alt_approx(wpos2d).unwrap_or(0.0)),
+                        chunk,
+                    )
+                })
+            {
+                let biome = chunk.get_biome();
+                let Some(species) = [
+                    Some(comp::body::biped_large::Species::Ogre),
+                    Some(comp::body::biped_large::Species::Cyclops),
+                    Some(comp::body::biped_large::Species::Wendigo).filter(|_| biome == BiomeKind::Taiga),
+                    Some(comp::body::biped_large::Species::Cavetroll),
+                    Some(comp::body::biped_large::Species::Mountaintroll).filter(|_| biome == BiomeKind::Mountain),
+                    Some(comp::body::biped_large::Species::Swamptroll).filter(|_| biome == BiomeKind::Swamp),
+                    Some(comp::body::biped_large::Species::Blueoni),
+                    Some(comp::body::biped_large::Species::Redoni),
+                    Some(comp::body::biped_large::Species::Tursus).filter(|_| chunk.temp < CONFIG.snow_temp),
+                ]
+                    .into_iter()
+                    .flatten()
+                    .choose(&mut rng)
+                else { continue };
+
+                this.npcs.create_npc(Npc::new(
+                    rng.gen(),
+                    wpos,
+                    Body::BipedLarge(comp::body::biped_large::Body::random_with(
+                        &mut rng, &species,
+                    )),
+                    Role::Monster,
+                ));
+            }
+        }
+
         info!("Generated {} rtsim NPCs.", this.npcs.len());
 
         this

rtsim/src/rule/npc_ai.rs

@@ -11,9 +11,13 @@ use crate::{
 };
 use common::{
     astar::{Astar, PathResult},
-    comp::{compass::Direction, Content},
+    comp::{
+        compass::{Direction, Distance},
+        dialogue::Subject,
+        Content,
+    },
     path::Path,
-    rtsim::{Actor, ChunkResource, Profession, SiteId},
+    rtsim::{Actor, ChunkResource, NpcInput, Profession, Role, SiteId},
     spiral::Spiral2d,
     store::Id,
     terrain::{CoordinateConversions, SiteKindMeta, TerrainChunkSize},
@@ -547,28 +551,16 @@ fn timeout(time: f64) -> impl FnMut(&mut NpcCtx) -> bool + Clone + Send + Sync {
     move |ctx| ctx.time.0 > *timeout.get_or_insert(ctx.time.0 + time)
 }
 
-fn socialize() -> impl Action {
+fn talk_to(tgt: Actor, _subject: Option<Subject>) -> impl Action {
-    now(|ctx| {
+    now(move |ctx| {
-        // Skip most socialising actions if we're not loaded
+        if matches!(tgt, Actor::Npc(_)) && ctx.rng.gen_bool(0.2) {
-        if matches!(ctx.npc.mode, SimulationMode::Loaded) && ctx.rng.gen_bool(0.002) {
+            // Cut off the conversation sometimes to avoid infinite conversations (but only
-            if ctx.rng.gen_bool(0.15) {
+            // if the target is an NPC!) TODO: Don't special case this, have
-                return Either::Left(
+            // some sort of 'bored of conversation' system
-                    just(|ctx| ctx.controller.do_dance())
+            idle().l()
-                        .repeat()
+        } else {
-                        .stop_if(timeout(6.0))
+            // Mention nearby sites
-                        .debug(|| "dancing")
+            let comment = if ctx.rng.gen_bool(0.3)
-                        .map(|_| ())
-                        .boxed(),
-                );
-            } else if let Some(other) = ctx
-                .state
-                .data()
-                .npcs
-                .nearby(Some(ctx.npc_id), ctx.npc.wpos, 8.0)
-                .choose(&mut ctx.rng)
-            {
-                return Either::Left(
-                    just(move |ctx| ctx.controller.say(other, if ctx.rng.gen_bool(0.3)
                 && let Some(current_site) = ctx.npc.current_site
                 && let Some(current_site) = ctx.state.data().sites.get(current_site)
                 && let Some(mention_site) = current_site.nearby_sites_by_size.choose(&mut ctx.rng)
@@ -579,19 +571,68 @@ fn socialize() -> impl Action {
                 Content::localized_with_args("npc-speech-tell_site", [
                     ("site", Content::Plain(mention_site_name)),
                     ("dir", Direction::from_dir(mention_site.wpos.as_() - ctx.npc.wpos.xy()).localize_npc()),
+                    ("dist", Distance::from_length(mention_site.wpos.as_().distance(ctx.npc.wpos.xy()) as i32).localize_npc()),
+                ])
+            // Mention nearby monsters
+            } else if ctx.rng.gen_bool(0.3)
+                && let Some(monster) = ctx.state.data().npcs
+                    .values()
+                    .filter(|other| matches!(&other.role, Role::Monster))
+                    .min_by_key(|other| other.wpos.xy().distance(ctx.npc.wpos.xy()) as i32)
+            {
+                Content::localized_with_args("npc-speech-tell_monster", [
+                    ("body", monster.body.localize()),
+                    ("dir", Direction::from_dir(monster.wpos.xy() - ctx.npc.wpos.xy()).localize_npc()),
+                    ("dist", Distance::from_length(monster.wpos.xy().distance(ctx.npc.wpos.xy()) as i32).localize_npc()),
                 ])
             } else {
                 ctx.npc.personality.get_generic_comment(&mut ctx.rng)
-                    }))
+            };
-                    // After greeting the actor, wait for a while
+            // TODO: Don't special-case players
+            let wait = if matches!(tgt, Actor::Character(_)) {
+                0.0
+            } else {
+                1.5
+            };
+            idle()
+                .repeat()
+                .stop_if(timeout(wait))
+                .then(just(move |ctx| ctx.controller.say(tgt, comment.clone())))
+                .r()
+        }
+    })
+}
+
+fn socialize() -> impl Action {
+    now(|ctx| {
+        // Skip most socialising actions if we're not loaded
+        if matches!(ctx.npc.mode, SimulationMode::Loaded) && ctx.rng.gen_bool(0.002) {
+            // Sometimes dance
+            if ctx.rng.gen_bool(0.15) {
+                return just(|ctx| ctx.controller.do_dance())
+                    .repeat()
+                    .stop_if(timeout(6.0))
+                    .debug(|| "dancing")
+                    .map(|_| ())
+                    .l()
+                    .l();
+            // Talk to nearby NPCs
+            } else if let Some(other) = ctx
+                .state
+                .data()
+                .npcs
+                .nearby(Some(ctx.npc_id), ctx.npc.wpos, 8.0)
+                .choose(&mut ctx.rng)
+            {
+                return talk_to(other, None)
+                    // After talking, wait for a while
                     .then(idle().repeat().stop_if(timeout(4.0)))
                     .map(|_| ())
-                    .boxed(),
+                    .r().l();
-                );
             }
         }
 
-        Either::Right(idle())
+        idle().r()
     })
 }
 
@@ -619,7 +660,7 @@ fn adventure() -> impl Action {
             .min_by_key(|(_, site)| site.wpos.as_().distance(ctx.npc.wpos.xy()) as i32)
             .map(|(site_id, _)| site_id)
         {
-            let wait_time = if matches!(ctx.npc.profession, Some(Profession::Merchant)) {
+            let wait_time = if matches!(ctx.npc.profession(), Some(Profession::Merchant)) {
                 60.0 * 15.0
             } else {
                 60.0 * 3.0
@@ -737,7 +778,7 @@ fn villager(visiting_site: SiteId) -> impl Action {
         }
 
         if DayPeriod::from(ctx.time_of_day.0).is_dark()
-            && !matches!(ctx.npc.profession, Some(Profession::Guard))
+            && !matches!(ctx.npc.profession(), Some(Profession::Guard))
         {
             return important(
                 now(move |ctx| {
@@ -777,7 +818,7 @@ fn villager(visiting_site: SiteId) -> impl Action {
                 .debug(|| "find somewhere to sleep"),
             );
         // Villagers with roles should perform those roles
-        } else if matches!(ctx.npc.profession, Some(Profession::Herbalist)) && ctx.rng.gen_bool(0.8)
+        } else if matches!(ctx.npc.profession(), Some(Profession::Herbalist)) && ctx.rng.gen_bool(0.8)
         {
             if let Some(forest_wpos) = find_forest(ctx) {
                 return casual(
@@ -790,7 +831,7 @@ fn villager(visiting_site: SiteId) -> impl Action {
                         .map(|_| ()),
                 );
             }
-        } else if matches!(ctx.npc.profession, Some(Profession::Hunter)) && ctx.rng.gen_bool(0.8) {
+        } else if matches!(ctx.npc.profession(), Some(Profession::Hunter)) && ctx.rng.gen_bool(0.8) {
             if let Some(forest_wpos) = find_forest(ctx) {
                 return casual(
                     just(|ctx| {
@@ -806,7 +847,7 @@ fn villager(visiting_site: SiteId) -> impl Action {
                     .map(|_| ()),
                 );
             }
-        } else if matches!(ctx.npc.profession, Some(Profession::Guard)) && ctx.rng.gen_bool(0.7) {
+        } else if matches!(ctx.npc.profession(), Some(Profession::Guard)) && ctx.rng.gen_bool(0.7) {
             if let Some(plaza_wpos) = choose_plaza(ctx, visiting_site) {
                 return casual(
                     travel_to_point(plaza_wpos, 0.4)
@@ -824,7 +865,7 @@ fn villager(visiting_site: SiteId) -> impl Action {
                         .map(|_| ()),
                 );
             }
-        } else if matches!(ctx.npc.profession, Some(Profession::Merchant)) && ctx.rng.gen_bool(0.8)
+        } else if matches!(ctx.npc.profession(), Some(Profession::Merchant)) && ctx.rng.gen_bool(0.8)
         {
             return casual(
                 just(|ctx| {
@@ -963,10 +1004,12 @@ fn captain() -> impl Action {
 fn check_inbox(ctx: &mut NpcCtx) -> Option<impl Action> {
     loop {
         match ctx.inbox.pop_front() {
-            Some(report_id) if !ctx.known_reports.contains(&report_id) => {
+            Some(NpcInput::Report(report_id)) if !ctx.known_reports.contains(&report_id) => {
                 #[allow(clippy::single_match)]
                 match ctx.state.data().reports.get(report_id).map(|r| r.kind) {
-                    Some(ReportKind::Death { killer, actor, .. }) => {
+                    Some(ReportKind::Death { killer, actor, .. })
+                        if matches!(&ctx.npc.role, Role::Civilised(_)) =>
+                    {
                         // TODO: Don't report self
                         let phrase = if let Some(killer) = killer {
                             // TODO: For now, we don't make sentiment changes if the killer was an
@@ -1002,14 +1045,17 @@ fn check_inbox(ctx: &mut NpcCtx) -> Option<impl Action> {
                             "npc-speech-witness_death"
                         };
                         ctx.known_reports.insert(report_id);
-                        break Some(just(move |ctx| {
+                        break Some(
-                            ctx.controller.say(killer, Content::localized(phrase))
+                            just(move |ctx| ctx.controller.say(killer, Content::localized(phrase)))
-                        }));
+                                .l(),
+                        );
                     },
+                    Some(ReportKind::Death { .. }) => {}, // We don't care about death
                     None => {},                           // Stale report, ignore
                 }
             },
-            Some(_) => {}, // Reports we already know of are ignored
+            Some(NpcInput::Report(_)) => {}, // Reports we already know of are ignored
+            Some(NpcInput::Interaction(by, subject)) => break Some(talk_to(by, Some(subject)).r()),
             None => break None,
         }
     }
@@ -1057,14 +1103,14 @@ fn humanoid() -> impl Action {
             }
         } else {
             let action = if matches!(
-                ctx.npc.profession,
+                ctx.npc.profession(),
                 Some(Profession::Adventurer(_) | Profession::Merchant)
             ) {
-                adventure().boxed()
+                adventure().l().l()
             } else if let Some(home) = ctx.npc.home {
-                villager(home).boxed()
+                villager(home).r().l()
             } else {
-                idle().boxed() // Homeless
+                idle().r() // Homeless
             };
 
             casual(action.interrupt_with(react_to_events))
@@ -1114,10 +1160,28 @@ fn bird_large() -> impl Action {
     })
 }
 
+fn monster() -> impl Action {
+    let mut bearing = Vec2::zero();
+    now(move |ctx| {
+        bearing = bearing
+            .map(|e| e + ctx.rng.gen_range(-0.1..0.1))
+            .try_normalized()
+            .unwrap_or_default();
+        goto_2d(ctx.npc.wpos.xy() + bearing * 24.0, 0.7, 8.0)
+            .debug(move || format!("Moving with a bearing of {:?}", bearing))
+    })
+    .repeat()
+    .map(|_| ())
+}
+
 fn think() -> impl Action {
-    choose(|ctx| match ctx.npc.body {
+    now(|ctx| match ctx.npc.body {
-        common::comp::Body::Humanoid(_) => casual(humanoid()),
+        common::comp::Body::Humanoid(_) => humanoid().l().l().l(),
-        common::comp::Body::BirdLarge(_) => casual(bird_large()),
+        common::comp::Body::BirdLarge(_) => bird_large().r().l().l(),
-        _ => casual(socialize()),
+        _ => match &ctx.npc.role {
+            Role::Civilised(_) => socialize().l().r().l(),
+            Role::Monster => monster().r().r().l(),
+            Role::Wild => idle().r(),
+        },
     })
 }

rtsim/src/rule/report.rs

@@ -3,6 +3,7 @@ use crate::{
     event::{EventCtx, OnDeath},
     RtState, Rule, RuleError,
 };
+use common::rtsim::NpcInput;
 
 pub struct ReportEvents;
 
@@ -38,7 +39,7 @@ fn on_death(ctx: EventCtx<ReportEvents, OnDeath>) {
             // data structure in their own time.
             for npc_id in nearby {
                 if let Some(npc) = data.npcs.get_mut(npc_id) {
-                    npc.inbox.push_back(report);
+                    npc.inbox.push_back(NpcInput::Report(report));
                 }
             }
         }

rtsim/src/rule/simulate_npcs.rs

@@ -82,21 +82,25 @@ fn on_death(ctx: EventCtx<SimulateNpcs, OnDeath>) {
                             Body::Humanoid(comp::humanoid::Body::random_with(rng, species))
                         };
                         let npc_id = data.spawn_npc(
-                            Npc::new(rng.gen(), rand_wpos(&mut rng), random_humanoid(&mut rng))
+                            Npc::new(
+                                rng.gen(),
+                                rand_wpos(&mut rng),
+                                random_humanoid(&mut rng),
+                                npc.role.clone(),
+                            )
                             .with_personality(Personality::random(&mut rng))
                             .with_home(site_id)
-                                .with_faction(npc.faction)
+                            .with_faction(npc.faction),
-                                .with_profession(npc.profession.clone()),
                         );
-                        Some((npc_id, site_id))
+                        Some((npc_id, Some(site_id)))
                     } else {
                         warn!("No site found for respawning humanoid");
                         None
                     }
                 },
-                Body::BirdLarge(_) => {
+                body => {
-                    if let Some((site_id, site)) = data
+                    let home = npc.home.and_then(|_| {
-                        .sites
+                        data.sites
                             .iter()
                             .filter(|(id, site)| {
                                 Some(*id) != npc.home
@@ -105,44 +109,45 @@ fn on_death(ctx: EventCtx<SimulateNpcs, OnDeath>) {
                                     })
                             })
                             .min_by_key(|(_, site)| site.population.len())
-                    {
+                    });
-                        let rand_wpos = |rng: &mut ChaChaRng| {
+
-                            let wpos2d = site.wpos.map(|e| e + rng.gen_range(-10..10));
+                    let wpos = if let Some((_, home)) = home {
+                        let wpos2d = home.wpos.map(|e| e + rng.gen_range(-10..10));
+                        wpos2d
+                            .map(|e| e as f32 + 0.5)
+                            .with_z(ctx.world.sim().get_alt_approx(wpos2d).unwrap_or(0.0))
+                    } else {
+                        let pos = (0..10)
+                            .map(|_| {
+                                ctx.world
+                                    .sim()
+                                    .get_size()
+                                    .map(|sz| rng.gen_range(0..sz as i32))
+                            })
+                            .find(|pos| {
+                                ctx.world
+                                    .sim()
+                                    .get(*pos)
+                                    .map_or(false, |c| !c.is_underwater())
+                            })
+                            .unwrap_or(ctx.world.sim().get_size().as_() / 2);
+                        let wpos2d = pos.cpos_to_wpos_center();
                         wpos2d
                             .map(|e| e as f32 + 0.5)
                             .with_z(ctx.world.sim().get_alt_approx(wpos2d).unwrap_or(0.0))
                     };
-                        let species = [
+
-                            comp::body::bird_large::Species::Phoenix,
+                    let home = home.map(|(site_id, _)| site_id);
-                            comp::body::bird_large::Species::Cockatrice,
+
-                            comp::body::bird_large::Species::Roc,
-                        ]
-                        .choose(&mut rng)
-                        .unwrap();
                     let npc_id = data.npcs.create_npc(
-                            Npc::new(
+                        Npc::new(rng.gen(), wpos, body, npc.role.clone()).with_home(home),
-                                rng.gen(),
-                                rand_wpos(&mut rng),
-                                Body::BirdLarge(comp::body::bird_large::Body::random_with(
-                                    &mut rng, species,
-                                )),
-                            )
-                            .with_home(site_id),
                     );
-                        Some((npc_id, site_id))
+                    Some((npc_id, home))
-                    } else {
-                        warn!("No site found for respawning bird");
-                        None
-                    }
-                },
-                body => {
-                    error!("Tried to respawn rtsim NPC with invalid body: {:?}", body);
-                    None
                 },
             };
 
             // Add the NPC to their home site
-            if let Some((npc_id, home_site)) = details {
+            if let Some((npc_id, Some(home_site))) = details {
                 if let Some(home) = data.sites.get_mut(home_site) {
                     home.population.insert(npc_id);
                 }

rtsim/src/rule/sync_npcs.rs

@@ -2,7 +2,11 @@ use crate::{
     event::{EventCtx, OnDeath, OnSetup, OnTick},
     RtState, Rule, RuleError,
 };
-use common::{grid::Grid, rtsim::Actor, terrain::CoordinateConversions};
+use common::{
+    grid::Grid,
+    rtsim::{Actor, NpcInput},
+    terrain::CoordinateConversions,
+};
 
 pub struct SyncNpcs;
 
@@ -124,7 +128,8 @@ fn on_tick(ctx: EventCtx<SyncNpcs, OnTick>) {
                 npc.inbox.extend(site.known_reports
                     .iter()
                     .copied()
-                    .filter(|report| !npc.known_reports.contains(report)));
+                    .filter(|report| !npc.known_reports.contains(report))
+                    .map(NpcInput::Report));
             }
         }
 

server/src/cmd.rs

@@ -45,7 +45,7 @@ use common::{
     outcome::Outcome,
     parse_cmd_args,
     resources::{BattleMode, PlayerPhysicsSettings, Secs, Time, TimeOfDay},
-    rtsim::Actor,
+    rtsim::{Actor, Role},
     terrain::{Block, BlockKind, CoordinateConversions, SpriteKind, TerrainChunkSize},
     uid::{Uid, UidAllocator},
     vol::ReadVol,
@@ -1269,7 +1269,7 @@ fn handle_rtsim_info(
 
         let _ = writeln!(&mut info, "-- General Information --");
         let _ = writeln!(&mut info, "Seed: {}", npc.seed);
-        let _ = writeln!(&mut info, "Profession: {:?}", npc.profession);
+        let _ = writeln!(&mut info, "Role: {:?}", npc.role);
         let _ = writeln!(&mut info, "Home: {:?}", npc.home);
         let _ = writeln!(&mut info, "Faction: {:?}", npc.faction);
         let _ = writeln!(&mut info, "Personality: {:?}", npc.personality);
@@ -1321,10 +1321,14 @@ fn handle_rtsim_npc(
             .enumerate()
             .filter(|(idx, npc)| {
                 let tags = [
-                    npc.profession
+                    npc.profession()
-                        .as_ref()
                         .map(|p| format!("{:?}", p))
                         .unwrap_or_default(),
+                    match &npc.role {
+                        Role::Civilised(_) => "civilised".to_string(),
+                        Role::Wild => "wild".to_string(),
+                        Role::Monster => "monster".to_string(),
+                    },
                     format!("{:?}", npc.mode),
                     format!("{}", idx),
                 ];

server/src/events/interaction.rs

@@ -78,7 +78,12 @@ pub fn handle_lantern(server: &mut Server, entity: EcsEntity, enable: bool) {
     }
 }
 
-pub fn handle_npc_interaction(server: &mut Server, interactor: EcsEntity, npc_entity: EcsEntity) {
+pub fn handle_npc_interaction(
+    server: &mut Server,
+    interactor: EcsEntity,
+    npc_entity: EcsEntity,
+    subject: Subject,
+) {
     let state = server.state_mut();
     if let Some(agent) = state
         .ecs()
@@ -89,7 +94,7 @@ pub fn handle_npc_interaction(server: &mut Server, interactor: EcsEntity, npc_en
             if let Some(interactor_uid) = state.ecs().uid_from_entity(interactor) {
                 agent
                     .inbox
-                    .push_back(AgentEvent::Talk(interactor_uid, Subject::Regular));
+                    .push_back(AgentEvent::Talk(interactor_uid, subject));
             }
         }
     }

server/src/events/mod.rs

@@ -123,8 +123,8 @@ impl Server {
                 },
                 ServerEvent::EnableLantern(entity) => handle_lantern(self, entity, true),
                 ServerEvent::DisableLantern(entity) => handle_lantern(self, entity, false),
-                ServerEvent::NpcInteract(interactor, target) => {
+                ServerEvent::NpcInteract(interactor, target, subject) => {
-                    handle_npc_interaction(self, interactor, target)
+                    handle_npc_interaction(self, interactor, target, subject)
                 },
                 ServerEvent::InitiateInvite(interactor, target, kind) => {
                     handle_invite(self, interactor, target, kind)

server/src/rtsim/tick.rs

@@ -3,7 +3,7 @@
 use super::*;
 use crate::sys::terrain::NpcData;
 use common::{
-    comp::{self, Body, Presence, PresenceKind},
+    comp::{self, Agent, Body, Presence, PresenceKind},
     event::{EventBus, NpcBuilder, ServerEvent},
     generation::{BodyBuilder, EntityConfig, EntityInfo},
     resources::{DeltaTime, Time, TimeOfDay},
@@ -138,13 +138,13 @@ fn get_npc_entity_info(npc: &Npc, sites: &Sites, index: IndexRef) -> EntityInfo
     let pos = comp::Pos(npc.wpos);
 
     let mut rng = npc.rng(Npc::PERM_ENTITY_CONFIG);
-    if let Some(ref profession) = npc.profession {
+    if let Some(profession) = npc.profession() {
         let economy = npc.home.and_then(|home| {
             let site = sites.get(home)?.world_site?;
             index.sites.get(site).trade_information(site.id())
         });
 
-        let config_asset = humanoid_config(profession);
+        let config_asset = humanoid_config(&profession);
 
         let entity_config = EntityConfig::from_asset_expect_owned(config_asset)
             .with_body(BodyBuilder::Exact(npc.body));
@@ -156,9 +156,9 @@ fn get_npc_entity_info(npc: &Npc, sites: &Sites, index: IndexRef) -> EntityInfo
                 comp::Alignment::Npc
             })
             .with_economy(economy.as_ref())
-            .with_lazy_loadout(profession_extra_loadout(npc.profession.as_ref()))
+            .with_lazy_loadout(profession_extra_loadout(Some(&profession)))
             .with_alias(npc.get_name())
-            .with_agent_mark(profession_agent_mark(npc.profession.as_ref()))
+            .with_agent_mark(profession_agent_mark(Some(&profession)))
     } else {
         let config_asset = match npc.body {
             Body::BirdLarge(body) => match body.species {
@@ -169,14 +169,29 @@ fn get_npc_entity_info(npc: &Npc, sites: &Sites, index: IndexRef) -> EntityInfo
                 // which limits what species are used
                 _ => unimplemented!(),
             },
-            _ => unimplemented!(),
+            Body::BipedLarge(body) => match body.species {
+                comp::biped_large::Species::Ogre => "common.entity.wild.aggressive.ogre",
+                comp::biped_large::Species::Cyclops => "common.entity.wild.aggressive.cyclops",
+                comp::biped_large::Species::Wendigo => "common.entity.wild.aggressive.wendigo",
+                comp::biped_large::Species::Werewolf => "common.entity.wild.aggressive.werewolf",
+                comp::biped_large::Species::Cavetroll => "common.entity.wild.aggressive.cave_troll",
+                comp::biped_large::Species::Mountaintroll => {
+                    "common.entity.wild.aggressive.mountain_troll"
+                },
+                comp::biped_large::Species::Swamptroll => {
+                    "common.entity.wild.aggressive.swamp_troll"
+                },
+                comp::biped_large::Species::Blueoni => "common.entity.wild.aggressive.blue_oni",
+                comp::biped_large::Species::Redoni => "common.entity.wild.aggressive.red_oni",
+                comp::biped_large::Species::Tursus => "common.entity.wild.aggressive.tursus",
+                species => unimplemented!("rtsim spawning for {:?}", species),
+            },
+            body => unimplemented!("rtsim spawning for {:?}", body),
         };
         let entity_config = EntityConfig::from_asset_expect_owned(config_asset)
             .with_body(BodyBuilder::Exact(npc.body));
 
-        EntityInfo::at(pos.0)
+        EntityInfo::at(pos.0).with_entity_config(entity_config, Some(config_asset), &mut rng)
-            .with_entity_config(entity_config, Some(config_asset), &mut rng)
-            .with_alignment(comp::Alignment::Wild)
     }
 }
 
@@ -299,7 +314,10 @@ impl<'a> System<'a> for Sys {
                                 .with_health(health)
                                 .with_poise(poise)
                                 .with_inventory(inventory)
-                                .with_agent(agent)
+                                .with_agent(agent.map(|agent| Agent {
+                                    rtsim_outbox: Some(Default::default()),
+                                    ..agent
+                                }))
                                 .with_scale(scale)
                                 .with_loot(loot)
                                 .with_rtsim(RtSimEntity(npc_id)),
@@ -358,7 +376,10 @@ impl<'a> System<'a> for Sys {
                             .with_health(health)
                             .with_poise(poise)
                             .with_inventory(inventory)
-                            .with_agent(agent)
+                            .with_agent(agent.map(|agent| Agent {
+                                rtsim_outbox: Some(Default::default()),
+                                ..agent
+                            }))
                             .with_scale(scale)
                             .with_loot(loot)
                             .with_rtsim(RtSimEntity(npc_id)),
@@ -402,6 +423,9 @@ impl<'a> System<'a> for Sys {
                             .rtsim_controller
                             .actions
                             .extend(std::mem::take(&mut npc.controller.actions));
+                        if let Some(rtsim_outbox) = &mut agent.rtsim_outbox {
+                            npc.inbox.append(rtsim_outbox);
+                        }
                     }
                 });
         }

server/src/sys/agent/behavior_tree.rs

@@ -4,6 +4,7 @@ use common::{
             AgentEvent, AwarenessState, Target, TimerAction, DEFAULT_INTERACTION_TIME,
             TRADE_INTERACTION_TIME,
         },
+        dialogue::Subject,
         Agent, Alignment, BehaviorCapability, BehaviorState, Body, BuffKind, ControlAction,
         ControlEvent, Controller, InputKind, InventoryEvent, Pos, UtteranceKind,
     },
@@ -494,8 +495,13 @@ fn handle_rtsim_actions(bdata: &mut BehaviorData) -> bool {
                             .timer
                             .start(bdata.read_data.time.0, TimerAction::Interact);
                         bdata.controller.push_action(ControlAction::Stand);
-                    }
 
+                        if let Some(target_uid) = bdata.read_data.uids.get(target) {
+                            bdata
+                                .controller
+                                .push_event(ControlEvent::Interact(*target_uid, Subject::Regular));
+                        }
+                    }
                     bdata.controller.push_utterance(UtteranceKind::Greeting);
                     bdata.agent_data.chat_npc(msg, bdata.event_emitter);
                 }

server/src/sys/agent/behavior_tree/interaction.rs

@@ -10,7 +10,7 @@ use common::{
         UtteranceKind,
     },
     event::ServerEvent,
-    rtsim::PersonalityTrait,
+    rtsim::{Actor, NpcInput, PersonalityTrait},
     trade::{TradeAction, TradePhase, TradeResult},
 };
 use rand::{thread_rng, Rng};
@@ -87,8 +87,26 @@ pub fn handle_inbox_talk(bdata: &mut BehaviorData) -> bool {
     }
 
     if let Some(AgentEvent::Talk(by, subject)) = agent.inbox.pop_front() {
+        let by_entity = get_entity_by_id(by.id(), read_data);
+
+        if let Some(rtsim_outbox) = &mut agent.rtsim_outbox {
+            if let Subject::Regular
+                | Subject::Mood
+                | Subject::Work = subject
+                && let Some(by_entity) = by_entity
+                && let Some(actor) = read_data.presences
+                    .get(by_entity)
+                    .and_then(|p| p.kind.character_id().map(Actor::Character))
+                    .or_else(|| Some(Actor::Npc(read_data.rtsim_entities
+                        .get(by_entity)?.0)))
+            {
+                rtsim_outbox.push_back(NpcInput::Interaction(actor, subject));
+                return false;
+            }
+        }
+
         if agent.allowed_to_speak() {
-            if let Some(target) = get_entity_by_id(by.id(), read_data) {
+            if let Some(target) = by_entity {
                 let target_pos = read_data.positions.get(target).map(|pos| pos.0);
 
                 agent.target = Some(Target::new(
@@ -216,14 +234,17 @@ pub fn handle_inbox_talk(bdata: &mut BehaviorData) -> bool {
                         if let Some(src_pos) = read_data.positions.get(target) {
                             // TODO: Localise
                             let msg = if let Some(person_pos) = person.origin {
-                                let distance = Distance::from_dir(person_pos.xy() - src_pos.0.xy());
+                                let distance =
+                                    Distance::from_dir(person_pos.xy().as_() - src_pos.0.xy());
                                 match distance {
                                     Distance::NextTo | Distance::Near => {
                                         format!(
                                             "{} ? I think he's {} {} from here!",
                                             person.name(),
                                             distance.name(),
-                                            Direction::from_dir(person_pos.xy() - src_pos.0.xy(),)
+                                            Direction::from_dir(
+                                                person_pos.xy().as_() - src_pos.0.xy()
+                                            )
                                             .name()
                                         )
                                     },

voxygen/src/session/mod.rs

@@ -15,6 +15,7 @@ use client::{self, Client};
 use common::{
     comp,
     comp::{
+        dialogue::Subject,
         inventory::slot::{EquipSlot, Slot},
         invite::InviteKind,
         item::{tool::ToolKind, ItemDesc},
@@ -959,7 +960,7 @@ impl PlayState for SessionState {
                                                     // TODO: maybe start crafting instead?
                                                     client.toggle_sit();
                                                 } else {
-                                                    client.npc_interact(*entity);
+                                                    client.npc_interact(*entity, Subject::Regular);
                                                 }
                                             },
                                         }